| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Leu-Pro-Tyr [CHEBI:73581] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:73581] |
| ChEBI Compound Description: |
A tripeptide composed of L-leucine, L-proline and L-tyrosine joined in sequence by peptide linkages. |
| ChEBI Compound Identification Number: |
73581 |
| ChEBI InChI Value: |
InChI=1S/C20H29N3O5/c1-12(2)10-15(21)19(26)23-9-3-4-17(23)18(25)22-16(20(27)28)11-13-5-7-14(24)8-6-13/h5-8,12,15-17,24H,3-4,9-11,21H2,1-2H3,(H,22,25)(H,27,28)/t15-,16-,17-/m0/s1 |
| ChEBI InChIKey Value: |
UCXQIIIFOOGYEM-ULQDDVLXSA-N |
| ChEBI Compound Name: |
Leu-Pro-Tyr |
| ChEBI SMILES Value: |
CC(C)C[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(O)=O |
| ChEBI Substance ID: |
163425927 |
| ChEBI URL: |
ChEBI:73581 |
| ChemSpider ID: |
9409765 |
| Ontomatica Chemical Accession Key (OnChAKey): |
UCXQIIIFOOGYEM_ULQDDVLXSA_N_000_000000 |
| PubChem Compound ID: |
11234718 |