Item 1 of 1 (back to results) pralatrexate A pteridine that is the N-4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl derivative of L-glutamic acid. Used for treatment of Peripheral T-Cell Lymphoma, an aggressive form of non-Hodgkins lymphoma.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > antimetabolite [CHEBI:35221] > pralatrexate [CHEBI:71223] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   dihydrofolate reductase inhibitor [CHEBI:50683] (7)   pralatrexate [CHEBI:71223] (1)  antimetabolite [CHEBI:35221] (34)   pralatrexate [CHEBI:71223] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   pralatrexate [CHEBI:71223] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  acetylenic compound [CHEBI:73474] (106)   terminal acetylenic compound [CHEBI:73477] (54)   pralatrexate [CHEBI:71223] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pralatrexate [CHEBI:71223] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1)  acetylenic compound [CHEBI:73474] (106)   terminal acetylenic compound [CHEBI:73477] (54)   pralatrexate [CHEBI:71223] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   glutamic acid derivative [CHEBI:24315] (42)   N-acylglutamic acid [CHEBI:21658] (4)   N-acyl-L-glutamic acid [CHEBI:21650] (3)   pralatrexate [CHEBI:71223] (1) ChEBI Compound Accession Identifier:   [CHEBI:71223] ChEBI Compound Description:   A pteridine that is the N-4-[1-(2,4-diaminopteridin-6-yl)pent-4-yn-2-yl]benzoyl derivative of L-glutamic acid. Used for treatment of Peripheral T-Cell Lymphoma, an aggressive form of non-Hodgkins lymphoma. ChEBI Compound Identification Number:   71223 ChEBI InChI Value:   InChI=1S/C23H23N7O5/c1-2-3-14(10-15-11-26-20-18(27-15)19(24)29-23(25)30-20)12-4-6-13(7-5-12)21(33)28-16(22(34)35)8-9-17(31)32/h1,4-7,11,14,16H,3,8-10H2,(H,28,33)(H,31,32)(H,34,35)(H4,24,25,26,29,30)/t14?,16-/m0/s1 ChEBI InChIKey Value:   OGSBUKJUDHAQEA-WMCAAGNKSA-N ChEBI Compound Name:   pralatrexate ChEBI SMILES Value:   Nc1nc(N)c2nc(CC(CC#C)c3ccc(cc3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)cnc2n1 ChEBI Substance ID:   160646081 ChEBI URL:   ChEBI:71223 ChemSpider ID:   130578 Ontomatica Chemical Accession Key (OnChAKey):   OGSBUKJUDHAQEA_WMCAAGNKSA_N_000_000000 PubChem Compound ID:   148121