Item 1 of 1 (back to results) purpurin A trihydroxyanthraquinone derived from anthracene by substitution with oxo groups at C-9 and C-10 and with hydroxy groups at C-1, C-2 and C-4.

Current search: 03. Biological Effects of Specific Chemicals: biophysical uses [CHEBI:52208] > biological pigment [CHEBI:26130] > purpurin [CHEBI:8645] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biophysical uses [CHEBI:52208] (136)   biological pigment [CHEBI:26130] (12)   purpurin [CHEBI:8645] (1) 05. Industrial Uses  05. Industrial Uses  dye [CHEBI:37958] (446)   purpurin [CHEBI:8645] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   trihydroxyanthraquinone [CHEBI:37488] (6)   purpurin [CHEBI:8645] (1) ChEBI Compound Accession Identifier:   [CHEBI:8645] ChEBI Compound Description:   A trihydroxyanthraquinone derived from anthracene by substitution with oxo groups at C-9 and C-10 and with hydroxy groups at C-1, C-2 and C-4. ChEBI Compound Identification Number:   8645 ChEBI InChI Value:   InChI=1S/C14H8O5/c15-8-5-9(16)14(19)11-10(8)12(17)6-3-1-2-4-7(6)13(11)18/h1-5,15-16,19H ChEBI InChIKey Value:   BBNQQADTFFCFGB-UHFFFAOYSA-N ChEBI Compound Name:   purpurin ChEBI SMILES Value:   Oc1cc(O)c2C(=O)c3ccccc3C(=O)c2c1O ChEBI Substance ID:   17487300 ChEBI URL:   ChEBI:8645 ChemSpider ID:   6431 Ontomatica Chemical Accession Key (OnChAKey):   BBNQQADTFFCFGB_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   6683