New Search

Item 1 of 1 (back to results)

bromfenac sodium salt
"The sodium salt of bromfenac. Note that 'bromfenac sodium' commonly refers to the sesquihydrate (120638-55-3); this is the anhydrous form."


Current search:

03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > analgesic [CHEBI:35480] > non-narcotic analgesic [CHEBI:35481] > bromfenac sodium salt [CHEBI:140536]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 analgesic [CHEBI:35480] (114) 
 non-narcotic analgesic [CHEBI:35481] (56) 
 bromfenac sodium salt [CHEBI:140536] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 anti-inflammatory drug [CHEBI:35472] (112) 
 non-steroidal anti-inflammatory drug [CHEBI:35475] (71) 
 bromfenac sodium salt [CHEBI:140536] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 alkali metal molecular entity [CHEBI:33296] (279) 
 sodium molecular entity [CHEBI:26712] (216) 
 sodium salt [CHEBI:26714] (213) 
 organic sodium salt [CHEBI:38700] (187) 
 bromfenac sodium salt [CHEBI:140536] (1)
 alkali metal salt [CHEBI:35479] (248) 
 sodium salt [CHEBI:26714] (213) 
 organic sodium salt [CHEBI:38700] (187) 
 bromfenac sodium salt [CHEBI:140536] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 bromine molecular entity [CHEBI:22928] (199) 
 organobromine compound [CHEBI:37141] (138) 
 bromfenac sodium salt [CHEBI:140536] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bromfenac sodium salt [CHEBI:140536] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 benzophenones [CHEBI:22726] (17) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 benzophenones [CHEBI:22726] (17) 
 bromfenac sodium salt [CHEBI:140536] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 benzophenones [CHEBI:22726] (17) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 benzophenones [CHEBI:22726] (17) 
 bromfenac sodium salt [CHEBI:140536] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 benzenes [CHEBI:22712] (386) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 aromatic amine [CHEBI:33860] (91) 
 anilines [CHEBI:22562] (73) 
 substituted aniline [CHEBI:48975] (61) 
 bromfenac sodium salt [CHEBI:140536] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 benzophenones [CHEBI:22726] (17) 
 bromfenac sodium salt [CHEBI:140536] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 salt [CHEBI:24866] (931) 
 organic salt [CHEBI:24868] (775) 
 organic sodium salt [CHEBI:38700] (187) 
 bromfenac sodium salt [CHEBI:140536] (1)
 alkali metal salt [CHEBI:35479] (248) 
 sodium salt [CHEBI:26714] (213) 
 organic sodium salt [CHEBI:38700] (187) 
 bromfenac sodium salt [CHEBI:140536] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bromfenac sodium salt [CHEBI:140536] (1)
ChEBI Compound Accession Identifier  [CHEBI:140536]
ChEBI Compound Description  "The sodium salt of bromfenac. Note that 'bromfenac sodium' commonly refers to the sesquihydrate (120638-55-3); this is the anhydrous form."
ChEBI Compound Identification Number  140536
ChEBI InChI Value  "InChI=1S/C15H12BrNO3.Na/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19;/h1-7H,8,17H2,(H,18,19);/q;+1/p-1"
ChEBI InChIKey Value  HZFGMQJYAFHESD-UHFFFAOYSA-M
ChEBI Compound Name  bromfenac sodium salt
ChEBI SMILES Value  [Na+].Nc1c(CC([O-])=O)cccc1C(=O)c1ccc(Br)cc1
ChEBI Substance ID  85340215
ChEBI URL  ChEBI:140536
ChemSpider ID  54729
Ontomatica Chemical Accession Key (OnChAKey)  HZFGMQJYAFHESD_UHFFFAOYSA_M_000_000000
PubChem Compound ID  23693301