Item 1 of 1 (back to results) bromfenac sodium salt "The sodium salt of bromfenac. Note that 'bromfenac sodium' commonly refers to the sesquihydrate (120638-55-3); this is the anhydrous form."

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > analgesic [CHEBI:35480] > non-narcotic analgesic [CHEBI:35481] > bromfenac sodium salt [CHEBI:140536] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   analgesic [CHEBI:35480] (114)   non-narcotic analgesic [CHEBI:35481] (56)   bromfenac sodium salt [CHEBI:140536] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   anti-inflammatory drug [CHEBI:35472] (112)   non-steroidal anti-inflammatory drug [CHEBI:35475] (71)   bromfenac sodium salt [CHEBI:140536] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   alkali metal molecular entity [CHEBI:33296] (279)   sodium molecular entity [CHEBI:26712] (216)   sodium salt [CHEBI:26714] (213)   organic sodium salt [CHEBI:38700] (187)   bromfenac sodium salt [CHEBI:140536] (1)  alkali metal salt [CHEBI:35479] (248)   sodium salt [CHEBI:26714] (213)   organic sodium salt [CHEBI:38700] (187)   bromfenac sodium salt [CHEBI:140536] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   bromfenac sodium salt [CHEBI:140536] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   bromfenac sodium salt [CHEBI:140536] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   benzophenones [CHEBI:22726] (17)   bromfenac sodium salt [CHEBI:140536] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   benzophenones [CHEBI:22726] (17)   bromfenac sodium salt [CHEBI:140536] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   bromfenac sodium salt [CHEBI:140536] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   benzophenones [CHEBI:22726] (17)   bromfenac sodium salt [CHEBI:140536] (1)  organic amino compound [CHEBI:50047] (2472)   aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   benzophenones [CHEBI:22726] (17)   bromfenac sodium salt [CHEBI:140536] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   benzenes [CHEBI:22712] (386)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  aromatic amine [CHEBI:33860] (91)   anilines [CHEBI:22562] (73)   substituted aniline [CHEBI:48975] (61)   bromfenac sodium salt [CHEBI:140536] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   benzophenones [CHEBI:22726] (17)   bromfenac sodium salt [CHEBI:140536] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   salt [CHEBI:24866] (931)   organic salt [CHEBI:24868] (775)   organic sodium salt [CHEBI:38700] (187)   bromfenac sodium salt [CHEBI:140536] (1)  alkali metal salt [CHEBI:35479] (248)   sodium salt [CHEBI:26714] (213)   organic sodium salt [CHEBI:38700] (187)   bromfenac sodium salt [CHEBI:140536] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   bromfenac sodium salt [CHEBI:140536] (1) ChEBI Compound Accession Identifier:   [CHEBI:140536] ChEBI Compound Description:   "The sodium salt of bromfenac. Note that 'bromfenac sodium' commonly refers to the sesquihydrate (120638-55-3); this is the anhydrous form." ChEBI Compound Identification Number:   140536 ChEBI InChI Value:   "InChI=1S/C15H12BrNO3.Na/c16-11-6-4-9(5-7-11)15(20)12-3-1-2-10(14(12)17)8-13(18)19;/h1-7H,8,17H2,(H,18,19);/q;+1/p-1" ChEBI InChIKey Value:   HZFGMQJYAFHESD-UHFFFAOYSA-M ChEBI Compound Name:   bromfenac sodium salt ChEBI SMILES Value:   [Na+].Nc1c(CC([O-])=O)cccc1C(=O)c1ccc(Br)cc1 ChEBI Substance ID:   85340215 ChEBI URL:   ChEBI:140536 ChemSpider ID:   54729 Ontomatica Chemical Accession Key (OnChAKey):   HZFGMQJYAFHESD_UHFFFAOYSA_M_000_000000 PubChem Compound ID:   23693301