Select any link to see items in a related category.

more general categories	information about this item
03. Biological Effects of Specific Chemicals	03. Biological Effects of Specific Chemicals
pharmacological uses [CHEBI:52210] (736)
neurotransmitter agent [CHEBI:35942] (471)
cholinergic drug [CHEBI:38323] (108)
cholinergic antagonist [CHEBI:48873] (84)
muscarinic antagonist [CHEBI:48876] (61)	oxybutynin [CHEBI:7856] (1)
parasympatholytic [CHEBI:50370] (17)	oxybutynin [CHEBI:7856] (1)
05. Industrial Uses	05. Industrial Uses
pharmaceutical [CHEBI:52217] (1978)
drug [CHEBI:23888] (1930)
neuromuscular agent [CHEBI:51372] (51)
muscle relaxant [CHEBI:51371] (47)	oxybutynin [CHEBI:7856] (1)
antispasmodic drug [CHEBI:53784] (18)	oxybutynin [CHEBI:7856] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
s-block molecular entity [CHEBI:33674] (7287)
hydrogen molecular entity [CHEBI:33608] (6932)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
tertiary alcohol [CHEBI:26878] (183)	oxybutynin [CHEBI:7856] (2)
p-block molecular entity [CHEBI:33675] (25343)
pnictogen molecular entity [CHEBI:33302] (10027)
nitrogen molecular entity [CHEBI:51143] (7930)
organonitrogen compound [CHEBI:35352] (6705)
organic amino compound [CHEBI:50047] (2472)
amine [CHEBI:32952] (179)
tertiary amine [CHEBI:32876] (84)	oxybutynin [CHEBI:7856] (2)
tertiary amino compound [CHEBI:50996] (199)
tertiary amine [CHEBI:32876] (84)	oxybutynin [CHEBI:7856] (2)
chalcogen molecular entity [CHEBI:33304] (15225)
oxygen molecular entity [CHEBI:25806] (14414)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
tertiary alcohol [CHEBI:26878] (183)	oxybutynin [CHEBI:7856] (2)
organooxygen compound [CHEBI:36963] (11352)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
acetate ester [CHEBI:47622] (184)	oxybutynin [CHEBI:7856] (2)
organochalcogen compound [CHEBI:36962] (11874)
organooxygen compound [CHEBI:36963] (11352)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
acetate ester [CHEBI:47622] (184)	oxybutynin [CHEBI:7856] (2)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organonitrogen compound [CHEBI:35352] (6705)
organic amino compound [CHEBI:50047] (2472)
amine [CHEBI:32952] (179)
tertiary amine [CHEBI:32876] (84)	oxybutynin [CHEBI:7856] (2)
tertiary amino compound [CHEBI:50996] (199)
tertiary amine [CHEBI:32876] (84)	oxybutynin [CHEBI:7856] (2)
organochalcogen compound [CHEBI:36962] (11874)
organooxygen compound [CHEBI:36963] (11352)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
acetate ester [CHEBI:47622] (184)	oxybutynin [CHEBI:7856] (2)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
tertiary alcohol [CHEBI:26878] (183)	oxybutynin [CHEBI:7856] (2)
ester [CHEBI:35701] (3370)
carboxylic ester [CHEBI:33308] (1495)
acetate ester [CHEBI:47622] (184)	oxybutynin [CHEBI:7856] (2)
organic amino compound [CHEBI:50047] (2472)
amine [CHEBI:32952] (179)
tertiary amine [CHEBI:32876] (84)	oxybutynin [CHEBI:7856] (2)
tertiary amino compound [CHEBI:50996] (199)
tertiary amine [CHEBI:32876] (84)	oxybutynin [CHEBI:7856] (2)
organic molecule [CHEBI:72695] (11399)
organic oxo compound [CHEBI:36587] (5932)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
acetate ester [CHEBI:47622] (184)	oxybutynin [CHEBI:7856] (2)
acetylenic compound [CHEBI:73474] (106)	oxybutynin [CHEBI:7856] (2)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
organic molecule [CHEBI:72695] (11399)
organic oxo compound [CHEBI:36587] (5932)
carbonyl compound [CHEBI:36586] (5928)
carboxylic ester [CHEBI:33308] (1495)
acetate ester [CHEBI:47622] (184)	oxybutynin [CHEBI:7856] (2)
acetylenic compound [CHEBI:73474] (106)	oxybutynin [CHEBI:7856] (2)
heteroatomic molecular entity [CHEBI:37577] (13672)
hydroxides [CHEBI:24651] (5641)
organic hydroxy compound [CHEBI:33822] (3050)
alcohol [CHEBI:30879] (1371)
tertiary alcohol [CHEBI:26878] (183)	oxybutynin [CHEBI:7856] (2)
ChEBI Compound Accession Identifier:	[CHEBI:7856]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	7856
ChEBI InChI Value:	InChI=1S/C22H31NO3/c1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3
ChEBI InChIKey Value:	XIQVNETUBQGFHX-UHFFFAOYSA-N
ChEBI Compound Name:	oxybutynin
ChEBI SMILES Value:	CCN(CC)CC#CCOC(=O)C(O)(C1CCCCC1)c1ccccc1
ChEBI Substance ID:	56464138
ChEBI URL:	ChEBI:7856
ChemSpider ID:	NS
Ontomatica Chemical Accession Key (OnChAKey):	XIQVNETUBQGFHX_UHFFFAOYSA_N_000_000000
PubChem Compound ID:	4634