New Search

Item 1 of 1 (back to results)

deptropine
An azabicycloalkane that is the 10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl ether of tropine.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 neurotransmitter agent [CHEBI:35942] (471) 
 histaminergic drug [CHEBI:37957] (94) 
 histamine antagonist [CHEBI:37956] (87) 
 H1-receptor antagonist [CHEBI:37955] (57) 
 deptropine [CHEBI:50189] (1)
 cholinergic drug [CHEBI:38323] (108) 
 cholinergic antagonist [CHEBI:48873] (84) 
 muscarinic antagonist [CHEBI:48876] (61) 
 deptropine [CHEBI:50189] (1)
 parasympatholytic [CHEBI:50370] (17) 
 deptropine [CHEBI:50189] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 deptropine [CHEBI:50189] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 deptropine [CHEBI:50189] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 deptropine [CHEBI:50189] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 deptropine [CHEBI:50189] (1)
ChEBI Compound Accession Identifier  [CHEBI:50189]
ChEBI Compound Description  An azabicycloalkane that is the 10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl ether of tropine.
ChEBI Compound Identification Number  50189
ChEBI InChI Value  InChI=1S/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+
ChEBI InChIKey Value  ZWPODSUQWXAZNC-PMOLBWCYSA-N
ChEBI Compound Name  deptropine
ChEBI SMILES Value  CN1[C@H]2CC[C@@H]1C[C@@H](C2)OC1c2ccccc2CCc2ccccc12
ChEBI Substance ID  56353031
ChEBI URL  ChEBI:50189
ChemSpider ID  16735768
Ontomatica Chemical Accession Key (OnChAKey)  ZWPODSUQWXAZNC_PMOLBWCYSA_N_000_000000
PubChem Compound ID  203911