Item 1 of 1 (back to results) 5-nonyloxytryptamine A tryptamine derivative that consists of serotonin bearing an additional O-nonyl substituent. 5-HT1B selective agonist, several times more potent than sumatriptan and inactive as a 5-HT1A agonist (Ki at 5-HT1B = 1 nM, selectivity over 5-HT1A > 300-fold).

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > serotonergic drug [CHEBI:48278] > serotonergic agonist [CHEBI:35941] > 5-nonyloxytryptamine [CHEBI:64149] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   serotonergic drug [CHEBI:48278] (109)   serotonergic agonist [CHEBI:35941] (41)   5-nonyloxytryptamine [CHEBI:64149] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic amino compound [CHEBI:50047] (2472)   primary amino compound [CHEBI:50994] (104)   5-nonyloxytryptamine [CHEBI:64149] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   5-nonyloxytryptamine [CHEBI:64149] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   5-nonyloxytryptamine [CHEBI:64149] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic amino compound [CHEBI:50047] (2472)   primary amino compound [CHEBI:50994] (104)   5-nonyloxytryptamine [CHEBI:64149] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic amino compound [CHEBI:50047] (2472)   primary amino compound [CHEBI:50994] (104)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  aromatic ether [CHEBI:35618] (353)   5-nonyloxytryptamine [CHEBI:64149] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  aromatic ether [CHEBI:35618] (353)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  aromatic ether [CHEBI:35618] (353)   5-nonyloxytryptamine [CHEBI:64149] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   polycyclic heteroarene [CHEBI:38180] (274)   benzopyrrole [CHEBI:22728] (227)   indoles [CHEBI:24828] (210)   tryptamines [CHEBI:27162] (26)   5-nonyloxytryptamine [CHEBI:64149] (1)  aromatic ether [CHEBI:35618] (353)   5-nonyloxytryptamine [CHEBI:64149] (1) ChEBI Compound Accession Identifier:   [CHEBI:64149] ChEBI Compound Description:   A tryptamine derivative that consists of serotonin bearing an additional O-nonyl substituent. 5-HT1B selective agonist, several times more potent than sumatriptan and inactive as a 5-HT1A agonist (Ki at 5-HT1B = 1 nM, selectivity over 5-HT1A > 300-fold). ChEBI Compound Identification Number:   64149 ChEBI InChI Value:   InChI=1S/C19H30N2O/c1-2-3-4-5-6-7-8-13-22-17-9-10-19-18(14-17)16(11-12-20)15-21-19/h9-10,14-15,21H,2-8,11-13,20H2,1H3 ChEBI InChIKey Value:   YHSMSRREJYOGQJ-UHFFFAOYSA-N ChEBI Compound Name:   5-nonyloxytryptamine ChEBI SMILES Value:   CCCCCCCCCOc1ccc2[nH]cc(CCN)c2c1 ChEBI Substance ID:   135610592 ChEBI URL:   ChEBI:64149 ChemSpider ID:   1731 Ontomatica Chemical Accession Key (OnChAKey):   YHSMSRREJYOGQJ_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   1797