Item 1 of 1 (back to results) fluphenazine A phenothiazine derivative having a trifluoromethyl subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position.

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > neurotransmitter agent [CHEBI:35942] > dopaminergic agent [CHEBI:48560] > dopaminergic antagonist [CHEBI:48561] > fluphenazine [CHEBI:5123] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  pharmacological uses [CHEBI:52210] (736)   neurotransmitter agent [CHEBI:35942] (471)   dopaminergic agent [CHEBI:48560] (99)   dopaminergic antagonist [CHEBI:48561] (48)   fluphenazine [CHEBI:5123] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   central nervous system drug [CHEBI:35470] (217)   psychotropic drug [CHEBI:35471] (130)   tranquilizing drug [CHEBI:35473] (83)   antipsychotic agent [CHEBI:35476] (51)   first generation antipsychotic [CHEBI:65190] (30)   phenothiazine antipsychotic drug [CHEBI:37930] (18)   fluphenazine [CHEBI:5123] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   fluphenazine [CHEBI:5123] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   fluphenazine [CHEBI:5123] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   fluphenazine [CHEBI:5123] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   heterotricyclic compound [CHEBI:36688] (541)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   piperazines [CHEBI:26144] (111)   N-alkylpiperazine [CHEBI:46845] (56)   fluphenazine [CHEBI:5123] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   organic heterotricyclic compound [CHEBI:26979] (541)   phenothiazines [CHEBI:38093] (35)   fluphenazine [CHEBI:5123] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organofluorine compound [CHEBI:37143] (275)   fluphenazine [CHEBI:5123] (1) ChEBI Compound Accession Identifier:   [CHEBI:5123] ChEBI Compound Description:   A phenothiazine derivative having a trifluoromethyl subsitituent at the 2-position and a 3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl group at the N-10 position. ChEBI Compound Identification Number:   5123 ChEBI InChI Value:   InChI=1S/C22H26F3N3OS/c23-22(24,25)17-6-7-21-19(16-17)28(18-4-1-2-5-20(18)30-21)9-3-8-26-10-12-27(13-11-26)14-15-29/h1-2,4-7,16,29H,3,8-15H2 ChEBI InChIKey Value:   PLDUPXSUYLZYBN-UHFFFAOYSA-N ChEBI Compound Name:   fluphenazine ChEBI SMILES Value:   OCCN1CCN(CCCN2c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1 ChEBI Substance ID:   92740963 ChEBI URL:   ChEBI:5123 ChemSpider ID:   3255 Ontomatica Chemical Accession Key (OnChAKey):   PLDUPXSUYLZYBN_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   3372