Item 1 of 1 (back to results) tetrahydromonapterin A tetrahydropterin that is monapterin tetrahydrogenated at positions 5, 6, 7 and 8.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > cofactor [CHEBI:23357] > tetrahydromonapterin [CHEBI:71177] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   cofactor [CHEBI:23357] (40)   tetrahydromonapterin [CHEBI:71177] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1)  organic aromatic compound [CHEBI:33659] (3593)   heteroarene [CHEBI:33833] (1648)   pteridines [CHEBI:26373] (87)   pterins [CHEBI:26375] (74)   neopterins [CHEBI:25500] (9)   tetrahydromonapterin [CHEBI:71177] (1)  tetrahydropterin [CHEBI:30436] (13)   tetrahydromonapterin [CHEBI:71177] (1) ChEBI Compound Accession Identifier:   [CHEBI:71177] ChEBI Compound Description:   A tetrahydropterin that is monapterin tetrahydrogenated at positions 5, 6, 7 and 8. ChEBI Compound Identification Number:   71177 ChEBI InChI Value:   InChI=1S/C9H15N5O4/c10-9-13-7-5(8(18)14-9)12-3(1-11-7)6(17)4(16)2-15/h3-4,6,12,15-17H,1-2H2,(H4,10,11,13,14,18)/t3?,4-,6-/m0/s1 ChEBI InChIKey Value:   XHIXPVCTDRNTTC-YQVKZWHSSA-N ChEBI Compound Name:   tetrahydromonapterin ChEBI SMILES Value:   Nc1nc2NCC(Nc2c(=O)[nH]1)[C@H](O)[C@@H](O)CO ChEBI Substance ID:   160646130 ChEBI URL:   ChEBI:71177 ChemSpider ID:   28533487 Ontomatica Chemical Accession Key (OnChAKey):   XHIXPVCTDRNTTC_YQVKZWHSSA_N_000_000000 PubChem Compound ID:   45479608