Select any link to see items in a related category.
more general categories information about this item 03. Biological Effects of Specific Chemicals 03. Biological Effects of Specific Chemicals pharmacological uses [CHEBI:52210] (736) agonist [CHEBI:48705] (68) PPARalpha agonist [CHEBI:70782] (3) clofibric acid [CHEBI:34648] (1) 05. Industrial Uses 05. Industrial Uses pharmaceutical [CHEBI:52217] (1978) drug [CHEBI:23888] (1930) antineoplastic agent [CHEBI:35610] (760) clofibric acid [CHEBI:34648] (1) antilipemic drug [CHEBI:35679] (30) clofibric acid [CHEBI:34648] (1) anticholesteremic drug [CHEBI:35821] (15) clofibric acid [CHEBI:34648] (1) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) p-block molecular entity [CHEBI:33675] (25343) halogen molecular entity [CHEBI:24471] (1475) chlorine molecular entity [CHEBI:23117] (884) organochlorine compound [CHEBI:36683] (543) clofibric acid [CHEBI:34648] (1) halide [CHEBI:37578] (1402) organohalogen compound [CHEBI:36684] (976) organochlorine compound [CHEBI:36683] (543) clofibric acid [CHEBI:34648] (1) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) heteroorganic entity [CHEBI:33285] (15197) organohalogen compound [CHEBI:36684] (976) organochlorine compound [CHEBI:36683] (543) clofibric acid [CHEBI:34648] (1) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) clofibric acid [CHEBI:34648] (1) halide [CHEBI:37578] (1402) organohalogen compound [CHEBI:36684] (976) organochlorine compound [CHEBI:36683] (543) clofibric acid [CHEBI:34648] (1) ChEBI Compound Accession Identifier: [CHEBI:34648] ChEBI Compound Description: A monocarboxylic acid that is isobutyric acid substituted at position 2 by a 4-chlorophenoxy group. ChEBI Compound Identification Number: 34648 ChEBI InChI Value: InChI=1S/C10H11ClO3/c1-10(2,9(12)13)14-8-5-3-7(11)4-6-8/h3-6H,1-2H3,(H,12,13) ChEBI InChIKey Value: TXCGAZHTZHNUAI-UHFFFAOYSA-N ChEBI Compound Name: clofibric acid ChEBI SMILES Value: CC(C)(Oc1ccc(Cl)cc1)C(O)=O ChEBI Substance ID: 49836655 ChEBI URL: ChEBI:34648 ChemSpider ID: NS Ontomatica Chemical Accession Key (OnChAKey): TXCGAZHTZHNUAI_UHFFFAOYSA_N_000_000000 PubChem Compound ID: 2797
