Select any link to see items in a related category.

more general categories	information about this item
03. Biological Effects of Specific Chemicals	03. Biological Effects of Specific Chemicals
biochemical uses [CHEBI:52206] (3306)
enzyme inhibitor [CHEBI:23924] (825)	ethacrynic acid [CHEBI:4876] (1)
biophysical uses [CHEBI:52208] (136)
membrane transport modulator [CHEBI:38632] (122)
ion transport inhibitor [CHEBI:50184] (2)	ethacrynic acid [CHEBI:4876] (1)
05. Industrial Uses	05. Industrial Uses
pharmaceutical [CHEBI:52217] (1978)
drug [CHEBI:23888] (1930)
diuretic [CHEBI:35498] (18)	ethacrynic acid [CHEBI:4876] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
p-block molecular entity [CHEBI:33675] (25343)
halogen molecular entity [CHEBI:24471] (1475)
chlorine molecular entity [CHEBI:23117] (884)
organochlorine compound [CHEBI:36683] (543)	ethacrynic acid [CHEBI:4876] (1)
halide [CHEBI:37578] (1402)
organohalogen compound [CHEBI:36684] (976)
organochlorine compound [CHEBI:36683] (543)	ethacrynic acid [CHEBI:4876] (1)
chalcogen molecular entity [CHEBI:33304] (15225)
oxygen molecular entity [CHEBI:25806] (14414)
organooxygen compound [CHEBI:36963] (11352)
ether [CHEBI:25698] (876)
aromatic ether [CHEBI:35618] (353)	ethacrynic acid [CHEBI:4876] (1)
organochalcogen compound [CHEBI:36962] (11874)
organooxygen compound [CHEBI:36963] (11352)
ether [CHEBI:25698] (876)
aromatic ether [CHEBI:35618] (353)	ethacrynic acid [CHEBI:4876] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organohalogen compound [CHEBI:36684] (976)
organochlorine compound [CHEBI:36683] (543)	ethacrynic acid [CHEBI:4876] (1)
organochalcogen compound [CHEBI:36962] (11874)
organooxygen compound [CHEBI:36963] (11352)
ether [CHEBI:25698] (876)
aromatic ether [CHEBI:35618] (353)	ethacrynic acid [CHEBI:4876] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic aromatic compound [CHEBI:33659] (3593)
aromatic ether [CHEBI:35618] (353)	ethacrynic acid [CHEBI:4876] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
aromatic compound [CHEBI:33655] (3799)
organic aromatic compound [CHEBI:33659] (3593)
aromatic ether [CHEBI:35618] (353)	ethacrynic acid [CHEBI:4876] (1)
organic cyclic compound [CHEBI:33832] (7633)
organic aromatic compound [CHEBI:33659] (3593)
aromatic ether [CHEBI:35618] (353)	ethacrynic acid [CHEBI:4876] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic aromatic compound [CHEBI:33659] (3593)
aromatic ether [CHEBI:35618] (353)	ethacrynic acid [CHEBI:4876] (1)
heteroatomic molecular entity [CHEBI:37577] (13672)
halide [CHEBI:37578] (1402)
organohalogen compound [CHEBI:36684] (976)
organochlorine compound [CHEBI:36683] (543)	ethacrynic acid [CHEBI:4876] (1)
ChEBI Compound Accession Identifier:	[CHEBI:4876]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	4876
ChEBI InChI Value:	InChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17)
ChEBI InChIKey Value:	AVOLMBLBETYQHX-UHFFFAOYSA-N
ChEBI Compound Name:	ethacrynic acid
ChEBI SMILES Value:	CCC(=C)C(=O)c1ccc(OCC(O)=O)c(Cl)c1Cl
ChEBI Substance ID:	50139238
ChEBI URL:	ChEBI:4876
ChemSpider ID:	3163
Ontomatica Chemical Accession Key (OnChAKey):	AVOLMBLBETYQHX_UHFFFAOYSA_N_000_000000
PubChem Compound ID:	3278