Item 1 of 1 (back to results) ceratamine A An organic heterobicyclic compound, which is imidazo[4,5-d]azepin-5(6H)-one substituted by a 3,5-dibromo-4-methoxybenzyl group at position 4, a methyl group at position 6 and a methylamino group at position 2. It is an antimitotic alkaloid isolated from the marine sponge Pseudoceratina.

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > antimitotic [CHEBI:64911] > ceratamine A [CHEBI:65608] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   ceratamine A [CHEBI:65608] (1)  pharmacological uses [CHEBI:52210] (736)   antimitotic [CHEBI:64911] (4)   ceratamine A [CHEBI:65608] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   ceratamine A [CHEBI:65608] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   ceratamine A [CHEBI:65608] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   ceratamine A [CHEBI:65608] (1)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   ceratamine A [CHEBI:65608] (1)  secondary amino compound [CHEBI:50995] (110)   ceratamine A [CHEBI:65608] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   ceratamine A [CHEBI:65608] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   ceratamine A [CHEBI:65608] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ceratamine A [CHEBI:65608] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   ceratamine A [CHEBI:65608] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ceratamine A [CHEBI:65608] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   ceratamine A [CHEBI:65608] (1)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   ceratamine A [CHEBI:65608] (1)  secondary amino compound [CHEBI:50995] (110)   ceratamine A [CHEBI:65608] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   ceratamine A [CHEBI:65608] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   ceratamine A [CHEBI:65608] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   ceratamine A [CHEBI:65608] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ceratamine A [CHEBI:65608] (1)  organic amino compound [CHEBI:50047] (2472)   amine [CHEBI:32952] (179)   tertiary amine [CHEBI:32876] (84)   ceratamine A [CHEBI:65608] (1)  secondary amino compound [CHEBI:50995] (110)   ceratamine A [CHEBI:65608] (1)  tertiary amino compound [CHEBI:50996] (199)   tertiary amine [CHEBI:32876] (84)   ceratamine A [CHEBI:65608] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   ceratamine A [CHEBI:65608] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ceratamine A [CHEBI:65608] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   ceratamine A [CHEBI:65608] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   ceratamine A [CHEBI:65608] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine A [CHEBI:65608] (1)  organic aromatic compound [CHEBI:33659] (3593)   aromatic ether [CHEBI:35618] (353)   ceratamine A [CHEBI:65608] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   ceratamine A [CHEBI:65608] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   ceratamine A [CHEBI:65608] (1) ChEBI Compound Accession Identifier:   [CHEBI:65608] ChEBI Compound Description:   An organic heterobicyclic compound, which is imidazo[4,5-d]azepin-5(6H)-one substituted by a 3,5-dibromo-4-methoxybenzyl group at position 4, a methyl group at position 6 and a methylamino group at position 2. It is an antimitotic alkaloid isolated from the marine sponge Pseudoceratina. ChEBI Compound Identification Number:   65608 ChEBI InChI Value:   InChI=1S/C17H16Br2N4O2/c1-20-17-21-13-4-5-23(2)16(24)10(14(13)22-17)6-9-7-11(18)15(25-3)12(19)8-9/h4-5,7-8H,6H2,1-3H3,(H,20,22) ChEBI InChIKey Value:   HAIJSTYZBPUVSG-UHFFFAOYSA-N ChEBI Compound Name:   ceratamine A ChEBI SMILES Value:   CNc1nc2ccn(C)c(=O)c(Cc3cc(Br)c(OC)c(Br)c3)c2n1 ChEBI Substance ID:   160645228 ChEBI URL:   ChEBI:65608 ChemSpider ID:   9662999 Ontomatica Chemical Accession Key (OnChAKey):   HAIJSTYZBPUVSG_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   11488186