Item 1 of 1 (back to results) ceratamine B An organic heterobicyclic compound, which is imidazo[4,5-d]azepin-5(6H)-one substituted by a 3,5-dibromo-4-methoxybenzyl group at position 4 and a methylamino group at position 2. It is an antimitotic alkaloid isolated from the marine sponge Pseudoceratina.

Current search: 03. Biological Effects of Specific Chemicals: pharmacological uses [CHEBI:52210] > antimitotic [CHEBI:64911] > ceratamine B [CHEBI:65609] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   ceratamine B [CHEBI:65609] (1)  pharmacological uses [CHEBI:52210] (736)   antimitotic [CHEBI:64911] (4)   ceratamine B [CHEBI:65609] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   ceratamine B [CHEBI:65609] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   ceratamine B [CHEBI:65609] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   ceratamine B [CHEBI:65609] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  organonitrogen compound [CHEBI:35352] (6705)   alkaloid [CHEBI:22315] (473)   ceratamine B [CHEBI:65609] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   ceratamine B [CHEBI:65609] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   ceratamine B [CHEBI:65609] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   ceratamine B [CHEBI:65609] (1) ChEBI Compound Accession Identifier:   [CHEBI:65609] ChEBI Compound Description:   An organic heterobicyclic compound, which is imidazo[4,5-d]azepin-5(6H)-one substituted by a 3,5-dibromo-4-methoxybenzyl group at position 4 and a methylamino group at position 2. It is an antimitotic alkaloid isolated from the marine sponge Pseudoceratina. ChEBI Compound Identification Number:   65609 ChEBI InChI Value:   InChI=1S/C16H14Br2N4O2/c1-19-16-21-12-3-4-20-15(23)9(13(12)22-16)5-8-6-10(17)14(24-2)11(18)7-8/h3-4,6-7H,5H2,1-2H3,(H,20,23)(H,19,21,22) ChEBI InChIKey Value:   UCJCVNFPNDGXHS-UHFFFAOYSA-N ChEBI Compound Name:   ceratamine B ChEBI SMILES Value:   CNc1nc2cc[nH]c(=O)c(Cc3cc(Br)c(OC)c(Br)c3)c2n1 ChEBI Substance ID:   160645221 ChEBI URL:   ChEBI:65609 ChemSpider ID:   10190117 Ontomatica Chemical Accession Key (OnChAKey):   UCJCVNFPNDGXHS_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   11201846