New Search

Item 1 of 1 (back to results)

O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester
The O-hydroxy(phenyl)phosphinoyl derivative of ecgonine methyl ester.


Current search:

03. Biological Effects of Specific Chemicals: epitope [CHEBI:53000] > O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 epitope [CHEBI:53000] (470) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 alkaloid [CHEBI:22315] (473) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 tropane alkaloid [CHEBI:37332] (17) 
 O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester [CHEBI:273574] (1)
ChEBI Compound Accession Identifier  [CHEBI:273574]
ChEBI Compound Description  The O-hydroxy(phenyl)phosphinoyl derivative of ecgonine methyl ester.
ChEBI Compound Identification Number  273574
ChEBI InChI Value  InChI=1S/C16H22NO5P/c1-17-11-8-9-13(17)15(16(18)21-2)14(10-11)22-23(19,20)12-6-4-3-5-7-12/h3-7,11,13-15H,8-10H2,1-2H3,(H,19,20)/t11-,13+,14-,15+/m0/s1
ChEBI InChIKey Value  WJTKWTJTOSZMKO-PMOUVXMZSA-N
ChEBI Compound Name  O-hydroxy(phenyl)phosphinoyl ecgonine methyl ester
ChEBI SMILES Value  [H][C@]12CC[C@]([H])([C@H]([C@H](C1)OP(O)(=O)c1ccccc1)C(=O)OC)N2C
ChEBI Substance ID  85466404
ChEBI URL  ChEBI:273574
ChemSpider ID  559089
Ontomatica Chemical Accession Key (OnChAKey)  WJTKWTJTOSZMKO_PMOUVXMZSA_N_000_000000
PubChem Compound ID  644013