| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
methylglyoxal-lysine dimer [CHEBI:59963] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:59963] |
| ChEBI Compound Description: |
An imidazolium ion formed via cyclo-dimerisation of L-lysine and methylglyoxal. |
| ChEBI Compound Identification Number: |
59963 |
| ChEBI InChI Value: |
InChI=1S/C16H28N4O4/c1-12-10-19(8-4-2-6-13(17)15(21)22)11-20(12)9-5-3-7-14(18)16(23)24/h10-11,13-14H,2-9,17-18H2,1H3,(H-,21,22,23,24)/p+1/t13-,14-/m0/s1 |
| ChEBI InChIKey Value: |
NVJLIMSDAPOFHF-KBPBESRZSA-O |
| ChEBI Compound Name: |
methylglyoxal-lysine dimer |
| ChEBI SMILES Value: |
Cc1cn(CCCC[C@H](N)C(O)=O)c[n+]1CCCC[C@H](N)C(O)=O |
| ChEBI Substance ID: |
99319571 |
| ChEBI URL: |
ChEBI:59963 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
NVJLIMSDAPOFHF_KBPBESRZSA_O_000_000000 |
| PubChem Compound ID: |
46878528 |