ChEFS (Wedge)

Item 1 of 1 (back to results)

Reactive Red 6 hapten copper complex
The copper coordination entity formed from Reactive Red 6 hapten by coordination to copper of the two hydroxy groups of each phenylazo-2-naphthyl substituent.

Current search:

Select any link to see items in a related category.

more general categories

information about this item

03. Biological Effects of Specific Chemicals

			epitope [CHEBI:53000] (470)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

08. Chemical Category

			transition element molecular entity [CHEBI:33497] (536)

					d-block molecular entity [CHEBI:33676] (500)

							copper group molecular entity [CHEBI:33745] (56)

								copper molecular entity [CHEBI:23377] (21)

									copper coordination entity [CHEBI:37403] (15)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

					transition element coordination entity [CHEBI:33861] (358)

						copper coordination entity [CHEBI:37403] (15)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

			main group molecular entity [CHEBI:33579] (25650)

					p-block molecular entity [CHEBI:33675] (25343)

						pnictogen molecular entity [CHEBI:33302] (10027)

								nitrogen molecular entity [CHEBI:51143] (7930)

									organonitrogen compound [CHEBI:35352] (6705)

organonitrogen heterocyclic compound [CHEBI:38101] (3202)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

									azo compound [CHEBI:37533] (51)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

bis(azo) compound [CHEBI:48960] (6)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

						chalcogen molecular entity [CHEBI:33304] (15225)

								sulfur molecular entity [CHEBI:26835] (1541)

organosulfur compound [CHEBI:33261] (1005)

organosulfonic acid [CHEBI:33551] (119)

arenesulfonic acid [CHEBI:33555] (62)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

sulfur oxoacid derivative [CHEBI:33424] (628)

sulfonic acid derivative [CHEBI:33552] (393)

organosulfonic acid [CHEBI:33551] (119)

arenesulfonic acid [CHEBI:33555] (62)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								organochalcogen compound [CHEBI:36962] (11874)

									organosulfur compound [CHEBI:33261] (1005)

organosulfonic acid [CHEBI:33551] (119)

arenesulfonic acid [CHEBI:33555] (62)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

						carbon group molecular entity [CHEBI:33582] (23847)

							organic molecular entity [CHEBI:50860] (23769)

								heteroorganic entity [CHEBI:33285] (15197)

organic heterocyclic compound [CHEBI:24532] (5243)

organic heteromonocyclic compound [CHEBI:25693] (2004)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organonitrogen heterocyclic compound [CHEBI:38101] (3202)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organonitrogen compound [CHEBI:35352] (6705)

organonitrogen heterocyclic compound [CHEBI:38101] (3202)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organochalcogen compound [CHEBI:36962] (11874)

organosulfur compound [CHEBI:33261] (1005)

organosulfonic acid [CHEBI:33551] (119)

arenesulfonic acid [CHEBI:33555] (62)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								organic molecule [CHEBI:72695] (11399)

									organic cyclic compound [CHEBI:33832] (7633)

organic heterocyclic compound [CHEBI:24532] (5243)

organic heteromonocyclic compound [CHEBI:25693] (2004)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organonitrogen heterocyclic compound [CHEBI:38101] (3202)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

carbocyclic compound [CHEBI:33598] (1130)

benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

carbopolycyclic compound [CHEBI:35294] (493)

carbobicyclic compound [CHEBI:36785] (199)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organic aromatic compound [CHEBI:33659] (3593)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

			polyatomic entity [CHEBI:36357] (18777)

				molecule [CHEBI:25367] (11520)

						cyclic compound [CHEBI:33595] (7817)

								homocyclic compound [CHEBI:33597] (1134)

carbocyclic compound [CHEBI:33598] (1130)

benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

carbopolycyclic compound [CHEBI:35294] (493)

carbobicyclic compound [CHEBI:36785] (199)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

homopolycyclic compound [CHEBI:35295] (493)

carbopolycyclic compound [CHEBI:35294] (493)

carbobicyclic compound [CHEBI:36785] (199)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								polycyclic compound [CHEBI:33635] (4078)

homopolycyclic compound [CHEBI:35295] (493)

carbopolycyclic compound [CHEBI:35294] (493)

carbobicyclic compound [CHEBI:36785] (199)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								bicyclic compound [CHEBI:33636] (1511)

carbobicyclic compound [CHEBI:36785] (199)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								aromatic compound [CHEBI:33655] (3799)

organic aromatic compound [CHEBI:33659] (3593)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								monocyclic compound [CHEBI:33661] (2007)

heteromonocyclic compound [CHEBI:33670] (2004)

organic heteromonocyclic compound [CHEBI:25693] (2004)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								organic cyclic compound [CHEBI:33832] (7633)

organic heterocyclic compound [CHEBI:24532] (5243)

organic heteromonocyclic compound [CHEBI:25693] (2004)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organonitrogen heterocyclic compound [CHEBI:38101] (3202)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

carbocyclic compound [CHEBI:33598] (1130)

benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

carbopolycyclic compound [CHEBI:35294] (493)

carbobicyclic compound [CHEBI:36785] (199)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organic aromatic compound [CHEBI:33659] (3593)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								heterocyclic compound [CHEBI:5686] (5275)

									organic heterocyclic compound [CHEBI:24532] (5243)

organic heteromonocyclic compound [CHEBI:25693] (2004)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organonitrogen heterocyclic compound [CHEBI:38101] (3202)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

									heteromonocyclic compound [CHEBI:33670] (2004)

organic heteromonocyclic compound [CHEBI:25693] (2004)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

						organic molecule [CHEBI:72695] (11399)

							organic cyclic compound [CHEBI:33832] (7633)

								organic heterocyclic compound [CHEBI:24532] (5243)

organic heteromonocyclic compound [CHEBI:25693] (2004)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

organonitrogen heterocyclic compound [CHEBI:38101] (3202)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								carbocyclic compound [CHEBI:33598] (1130)

benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

carbopolycyclic compound [CHEBI:35294] (493)

carbobicyclic compound [CHEBI:36785] (199)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

								organic aromatic compound [CHEBI:33659] (3593)

									heteroarene [CHEBI:33833] (1648)

azaarene [CHEBI:50893] (90)

triazines [CHEBI:38102] (61)

1,3,5-triazines [CHEBI:26588] (53)

diamino-1,3,5-triazine [CHEBI:38170] (22)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

									benzenoid aromatic compound [CHEBI:33836] (730)

benzenes [CHEBI:22712] (386)

azobenzenes [CHEBI:22682] (21)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

naphthalenes [CHEBI:25477] (89)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

				heteroatomic molecular entity [CHEBI:37577] (13672)

					coordination entity [CHEBI:33240] (498)

							transition element coordination entity [CHEBI:33861] (358)

								copper coordination entity [CHEBI:37403] (15)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

					oxoacid derivative [CHEBI:33241] (3254)

						sulfur oxoacid derivative [CHEBI:33424] (628)

							sulfonic acid derivative [CHEBI:33552] (393)

								organosulfonic acid [CHEBI:33551] (119)

									arenesulfonic acid [CHEBI:33555] (62)

naphthalenesulfonic acid [CHEBI:36336] (18)

Reactive Red 6 hapten copper complex [CHEBI:72307] (1)

ChEBI Compound Accession Identifier:

[CHEBI:72307]

ChEBI Compound Description:

The copper coordination entity formed from Reactive Red 6 hapten by coordination to copper of the two hydroxy groups of each phenylazo-2-naphthyl substituent.

ChEBI Compound Identification Number:

72307

ChEBI InChI Value:

"InChI=1S/C35H25N9O22S6.2Cu/c45-24-7-1-14(67(49,50)51)9-22(24)41-43-28-26(69(55,56)57)11-18-16(30(28)47)3-5-20(32(18)71(61,62)63)38-34-36-13-37-35(40-34)39-21-6-4-17-19(33(21)72(64,65)66)12-27(70(58,59)60)29(31(17)48)44-42-23-10-15(68(52,53)54)2-8-25(23)46;;/h1-13,45-48H,(H,49,50,51)(H,52,53,54)(H,55,56,57)(H,58,59,60)(H,61,62,63)(H,64,65,66)(H2,36,37,38,39,40);;/q;2*+2/p-4/b43-41+,44-42+;;"

ChEBI InChIKey Value:

PQDGEMLPCDBNLQ-KNZLDKEQSA-J

ChEBI Compound Name:

Reactive Red 6 hapten copper complex

ChEBI SMILES Value:

OS(=O)(=O)c1ccc2O[Cu]Oc3c(\N=N\c2c1)c(cc1c(c(Nc2ncnc(Nc4ccc5c6O[Cu]Oc7ccc(cc7\N=N\c6c(cc5c4S(O)(=O)=O)S(O)(=O)=O)S(O)(=O)=O)n2)ccc31)S(O)(=O)=O)S(O)(=O)=O

ChEBI Substance ID:

160962976

ChEBI URL:

ChEBI:72307

ChemSpider ID:

Ontomatica Chemical Accession Key (OnChAKey):

PQDGEMLPCDBNLQ_KNZLDKEQSA_J_000_000000

PubChem Compound ID:

70789018