Select any link to see items in a related category.
more general categories information about this item 03. Biological Effects of Specific Chemicals 03. Biological Effects of Specific Chemicals epitope [CHEBI:53000] (470) methoxy mycolic acid [CHEBI:59233] (1) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) p-block molecular entity [CHEBI:33675] (25343) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) lipid [CHEBI:18059] (3532) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) heteroorganic entity [CHEBI:33285] (15197) organochalcogen compound [CHEBI:36962] (11874) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) organic molecule [CHEBI:72695] (11399) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) fatty acid [CHEBI:35366] (487) branched-chain fatty acid [CHEBI:35819] (63) mycolic acid [CHEBI:25438] (8) methoxy mycolic acid [CHEBI:59233] (1) ChEBI Compound Accession Identifier: [CHEBI:59233] ChEBI Compound Description: A methoxylated fatty acid produced by Mycobacterium tuberculosis. ChEBI Compound Identification Number: 59233 ChEBI InChI Value: InChI=1S/C83H164O4/c1-5-7-9-11-13-15-17-19-21-23-24-25-26-30-37-43-49-55-61-67-73-80(83(85)86)81(84)74-68-62-56-50-44-38-31-27-29-35-41-47-53-59-65-71-78-76-79(78)72-66-60-54-48-42-36-32-33-39-45-51-57-63-69-75-82(87-4)77(3)70-64-58-52-46-40-34-28-22-20-18-16-14-12-10-8-6-2/h77-82,84H,5-76H2,1-4H3,(H,85,86) ChEBI InChIKey Value: KZLRXNDCHXPYTL-UHFFFAOYSA-N ChEBI Compound Name: methoxy mycolic acid ChEBI SMILES Value: CCCCCCCCCCCCCCCCCCCCCCC(C(O)CCCCCCCCCCCCCCCCCC1CC1CCCCCCCCCCCCCCCCC(OC)C(C)CCCCCCCCCCCCCCCCCC)C(O)=O ChEBI Substance ID: 92741735 ChEBI URL: ChEBI:59233 ChemSpider ID: NS Ontomatica Chemical Accession Key (OnChAKey): KZLRXNDCHXPYTL_UHFFFAOYSA_N_000_000000 PubChem Compound ID: 45266792