New Search

Item 1 of 1 (back to results)

keto mycolic acid
An oxo-substituted fatty acid produced by Mycobacterium tuberculosis.


Current search:

03. Biological Effects of Specific Chemicals: epitope [CHEBI:53000] > keto mycolic acid [CHEBI:59234]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 epitope [CHEBI:53000] (470) 
 keto mycolic acid [CHEBI:59234] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 organic molecule [CHEBI:72695] (11399) 
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 fatty acid [CHEBI:35366] (487) 
 branched-chain fatty acid [CHEBI:35819] (63) 
 mycolic acid [CHEBI:25438] (8) 
 keto mycolic acid [CHEBI:59234] (1)
ChEBI Compound Accession Identifier  [CHEBI:59234]
ChEBI Compound Description  An oxo-substituted fatty acid produced by Mycobacterium tuberculosis.
ChEBI Compound Identification Number  59234
ChEBI InChI Value  InChI=1S/C82H160O4/c1-4-6-8-10-12-14-16-18-20-22-23-24-25-29-36-42-48-54-60-66-72-79(82(85)86)81(84)74-68-62-56-50-44-38-30-26-28-34-40-46-52-58-64-70-77-75-78(77)71-65-59-53-47-41-35-31-32-37-43-49-55-61-67-73-80(83)76(3)69-63-57-51-45-39-33-27-21-19-17-15-13-11-9-7-5-2/h76-79,81,84H,4-75H2,1-3H3,(H,85,86)
ChEBI InChIKey Value  TWLOFRDXDXQZKV-UHFFFAOYSA-N
ChEBI Compound Name  keto mycolic acid
ChEBI SMILES Value  CCCCCCCCCCCCCCCCCCCCCCC(C(O)CCCCCCCCCCCCCCCCCC1CC1CCCCCCCCCCCCCCCCC(=O)C(C)CCCCCCCCCCCCCCCCCC)C(O)=O
ChEBI Substance ID  92741736
ChEBI URL  ChEBI:59234
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  TWLOFRDXDXQZKV_UHFFFAOYSA_N_000_000000
PubChem Compound ID  45266793