| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
prenyl diphosphate [CHEBI:16057] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:16057] |
| ChEBI Compound Description: |
A phosphoantigen comprising the O-pyrophosphate of prenol. |
| ChEBI Compound Identification Number: |
16057 |
| ChEBI InChI Value: |
InChI=1S/C5H12O7P2/c1-5(2)3-4-11-14(9,10)12-13(6,7)8/h3H,4H2,1-2H3,(H,9,10)(H2,6,7,8) |
| ChEBI InChIKey Value: |
CBIDRCWHNCKSTO-UHFFFAOYSA-N |
| ChEBI Compound Name: |
prenyl diphosphate |
| ChEBI SMILES Value: |
CC(C)=CCOP(O)(=O)OP(O)(O)=O |
| ChEBI Substance ID: |
8145704 |
| ChEBI URL: |
ChEBI:16057 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
CBIDRCWHNCKSTO_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
647 |