Select any link to see items in a related category.
more general categories information about this item 03. Biological Effects of Specific Chemicals 03. Biological Effects of Specific Chemicals hapten [CHEBI:59174] (92) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) 08. Chemical Category 08. Chemical Category main group molecular entity [CHEBI:33579] (25650) s-block molecular entity [CHEBI:33674] (7287) hydrogen molecular entity [CHEBI:33608] (6932) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) p-block molecular entity [CHEBI:33675] (25343) chalcogen molecular entity [CHEBI:33304] (15225) oxygen molecular entity [CHEBI:25806] (14414) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) sulfur molecular entity [CHEBI:26835] (1541) organosulfur compound [CHEBI:33261] (1005) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organochalcogen compound [CHEBI:36962] (11874) organosulfur compound [CHEBI:33261] (1005) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) carbon group molecular entity [CHEBI:33582] (23847) organic molecular entity [CHEBI:50860] (23769) heteroorganic entity [CHEBI:33285] (15197) organic heterocyclic compound [CHEBI:24532] (5243) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organochalcogen compound [CHEBI:36962] (11874) organosulfur compound [CHEBI:33261] (1005) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organooxygen compound [CHEBI:36963] (11352) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organic acid [CHEBI:64709] (3008) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) organic heterocyclic compound [CHEBI:24532] (5243) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) polyatomic entity [CHEBI:36357] (18777) molecule [CHEBI:25367] (11520) cyclic compound [CHEBI:33595] (7817) organic cyclic compound [CHEBI:33832] (7633) organic heterocyclic compound [CHEBI:24532] (5243) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) heterocyclic compound [CHEBI:5686] (5275) organic heterocyclic compound [CHEBI:24532] (5243) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organic molecule [CHEBI:72695] (11399) organic cyclic compound [CHEBI:33832] (7633) organic heterocyclic compound [CHEBI:24532] (5243) organosulfur heterocyclic compound [CHEBI:38106] (367) thiophenes [CHEBI:26961] (40) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) organic oxo compound [CHEBI:36587] (5932) carbonyl compound [CHEBI:36586] (5928) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) heteroatomic molecular entity [CHEBI:37577] (13672) hydroxides [CHEBI:24651] (5641) oxoacid [CHEBI:24833] (3119) carbon oxoacid [CHEBI:35605] (3012) carboxylic acid [CHEBI:33575] (3005) monocarboxylic acid [CHEBI:25384] (1620) 4-(2-thienyl)butyric acid [CHEBI:40114] (1) ChEBI Compound Accession Identifier: [CHEBI:40114] ChEBI Compound Description: A monocarboxylic acid that is butyric acid bearing a 2-thienyl group at position 4. ChEBI Compound Identification Number: 40114 ChEBI InChI Value: InChI=1S/C8H10O2S/c9-8(10)5-1-3-7-4-2-6-11-7/h2,4,6H,1,3,5H2,(H,9,10) ChEBI InChIKey Value: VYTXLSQVYGNWLV-UHFFFAOYSA-N ChEBI Compound Name: 4-(2-thienyl)butyric acid ChEBI SMILES Value: OC(=O)CCCc1cccs1 ChEBI Substance ID: 135668200 ChEBI URL: ChEBI:40114 ChemSpider ID: 70755 Ontomatica Chemical Accession Key (OnChAKey): VYTXLSQVYGNWLV_UHFFFAOYSA_N_000_000000 PubChem Compound ID: 78386
