New Search

Item 1 of 1 (back to results)

O-benzoylecgonine 5-carboxypentyl ester
An azabicycloalkane that consists of ecgonine having benzoyl and 5-carboxypentyl groups attached to the hydroxy and carboxy functions respectively.

Current search:

03. Biological Effects of Specific Chemicals: hapten [CHEBI:59174] > O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 hapten [CHEBI:59174] (92) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 ester [CHEBI:35701] (3370) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 aromatic ester [CHEBI:62732] (94) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 aromatic compound [CHEBI:33655] (3799) 
 aromatic ester [CHEBI:62732] (94) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 azabicycloalkane [CHEBI:38295] (38) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic ester [CHEBI:33308] (1495) 
 benzoate ester [CHEBI:36054] (83) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 monocarboxylic acid [CHEBI:25384] (1620) 
 O-benzoylecgonine 5-carboxypentyl ester [CHEBI:63312] (1)
ChEBI Compound Accession Identifier:   [CHEBI:63312]
ChEBI Compound Description:   An azabicycloalkane that consists of ecgonine having benzoyl and 5-carboxypentyl groups attached to the hydroxy and carboxy functions respectively.
ChEBI Compound Identification Number:   63312
ChEBI InChI Value:   InChI=1S/C22H29NO6/c1-23-16-11-12-17(23)20(22(27)28-13-7-3-6-10-19(24)25)18(14-16)29-21(26)15-8-4-2-5-9-15/h2,4-5,8-9,16-18,20H,3,6-7,10-14H2,1H3,(H,24,25)/t16-,17+,18-,20+/m0/s1
ChEBI InChIKey Value:   SORJFXHTZLIBBZ-HLNWXESRSA-N
ChEBI Compound Name:   O-benzoylecgonine 5-carboxypentyl ester
ChEBI SMILES Value:   [H][C@]12CC[C@]([H])([C@H]([C@H](C1)OC(=O)c1ccccc1)C(=O)OCCCCCC(O)=O)N2C
ChEBI Substance ID:   135610385
ChEBI URL:   ChEBI:63312
ChemSpider ID:   26333093
Ontomatica Chemical Accession Key (OnChAKey):   SORJFXHTZLIBBZ_HLNWXESRSA_N_000_000000
PubChem Compound ID:   56927737