| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
phenyl [1-(N-succinylamino)pentyl]phosphonate [CHEBI:43012] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:43012] |
| ChEBI Compound Description: |
A hapten and transition state analogue containing phenylphosphonate and succinoylamino moieties. |
| ChEBI Compound Identification Number: |
43012 |
| ChEBI InChI Value: |
InChI=1S/C15H22NO6P/c1-2-3-9-14(16-13(17)10-11-15(18)19)23(20,21)22-12-7-5-4-6-8-12/h4-8,14H,2-3,9-11H2,1H3,(H,16,17)(H,18,19)(H,20,21)/t14-/m1/s1 |
| ChEBI InChIKey Value: |
FJQWWGCHPFSERW-CQSZACIVSA-N |
| ChEBI Compound Name: |
phenyl [1-(N-succinylamino)pentyl]phosphonate |
| ChEBI SMILES Value: |
CCCC[C@H](NC(=O)CCC(O)=O)[P@](O)(=O)Oc1ccccc1 |
| ChEBI Substance ID: |
96079595 |
| ChEBI URL: |
ChEBI:43012 |
| ChemSpider ID: |
392114 |
| Ontomatica Chemical Accession Key (OnChAKey): |
FJQWWGCHPFSERW_CQSZACIVSA_N_000_000000 |
| PubChem Compound ID: |
444107 |