| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
|
|
|
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
|
|
|
|
|
|
|
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
|
|
|
|
|
|
|
|
|
|
N-(4-aminobutyl)dabigatranamide [CHEBI:73197] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:73197] |
| ChEBI Compound Description: |
The carboxamide formed from dabigatran by reaction of the carboxy group of its beta-alanine moiety with putrecine. |
| ChEBI Compound Identification Number: |
73197 |
| ChEBI InChI Value: |
InChI=1S/C29H35N9O2/c1-37-24-12-9-21(18-23(24)36-26(37)19-35-22-10-7-20(8-11-22)28(31)32)29(40)38(25-6-2-4-15-33-25)17-13-27(39)34-16-5-3-14-30/h2,4,6-12,15,18,35H,3,5,13-14,16-17,19,30H2,1H3,(H3,31,32)(H,34,39) |
| ChEBI InChIKey Value: |
YPNOCNAUIHBZMA-UHFFFAOYSA-N |
| ChEBI Compound Name: |
N-(4-aminobutyl)dabigatranamide |
| ChEBI SMILES Value: |
Cn1c(CNc2ccc(cc2)C(N)=N)nc2cc(ccc12)C(=O)N(CCC(=O)NCCCCN)c1ccccn1 |
| ChEBI Substance ID: |
162169345 |
| ChEBI URL: |
ChEBI:73197 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
YPNOCNAUIHBZMA_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
71306359 |