Item 1 of 1 (back to results) anthraflavic acid A tricyclic, aromatic compound derived from anthracene by the addition of hydroxy substituents at C-3 and C-7 and of oxo substituents at C-9 and C-10.

Current search: 03. Biological Effects of Specific Chemicals: antimutagen [CHEBI:73190] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimutagen [CHEBI:73190] (1)   anthraflavic acid [CHEBI:34250] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  polycyclic compound [CHEBI:33635] (4078)   homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   acenes [CHEBI:51269] (110)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic polycyclic compound [CHEBI:51958] (1654)   organic tricyclic compound [CHEBI:51959] (755)   carbotricyclic compound [CHEBI:38032] (198)   anthracenes [CHEBI:46955] (90)   anthraflavic acid [CHEBI:34250] (1)  anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   acenoquinone [CHEBI:51285] (62)   anthraquinone [CHEBI:22580] (53)   hydroxyanthraquinones [CHEBI:37485] (43)   dihydroxyanthraquinone [CHEBI:37484] (9)   anthraflavic acid [CHEBI:34250] (1) ChEBI Compound Accession Identifier:   [CHEBI:34250] ChEBI Compound Description:   A tricyclic, aromatic compound derived from anthracene by the addition of hydroxy substituents at C-3 and C-7 and of oxo substituents at C-9 and C-10. ChEBI Compound Identification Number:   34250 ChEBI InChI Value:   InChI=1S/C14H8O4/c15-7-1-3-9-11(5-7)14(18)10-4-2-8(16)6-12(10)13(9)17/h1-6,15-16H ChEBI InChIKey Value:   APAJFZPFBHMFQR-UHFFFAOYSA-N ChEBI Compound Name:   anthraflavic acid ChEBI SMILES Value:   Oc1ccc2C(=O)c3cc(O)ccc3C(=O)c2c1 ChEBI Substance ID:   17487286 ChEBI URL:   ChEBI:34250 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   APAJFZPFBHMFQR_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   6776