| more general categories    | 
information about this item | 
 | 
| 03. Biological Effects of Specific Chemicals  | 
  | 
  | 
 
 
 
 
 | 
03. Biological Effects of Specific Chemicals | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
  | 
| 04. Bioactive Capabilities of Specific Chemicals   | 
  | 
  | 
 
 
 
 
 | 
04. Bioactive Capabilities of Specific Chemicals  | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
  | 
| 08. Chemical Category  | 
  | 
  | 
 
 
 
 
 | 
08. Chemical Category | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 | 
 | 
| 
 | 
 streptothricin F(3+) [CHEBI:60822] (1) | 
 | 
  | 
| ChEBI Compound Accession Identifier:  | 
 [CHEBI:60822] | 
| ChEBI Compound Description:  | 
 A primary aliphatic ammonium ion which is obtained from streptothricin F by protonation of the guanidino and amino groups. | 
| ChEBI Compound Identification Number:  | 
 60822 | 
| ChEBI InChI Value:  | 
 InChI=1S/C19H34N8O8/c20-3-1-2-7(21)4-10(30)24-13-14(31)15(35-18(22)33)9(6-28)34-17(13)27-19-25-11-8(29)5-23-16(32)12(11)26-19/h7-9,11-15,17,28-29,31H,1-6,20-21H2,(H2,22,33)(H,23,32)(H,24,30)(H2,25,26,27)/p+3/t7-,8+,9+,11+,12-,13+,14-,15-,17+/m0/s1 | 
| ChEBI InChIKey Value:  | 
 NRAUADCLPJTGSF-VLSXYIQESA-Q | 
| ChEBI Compound Name:  | 
 streptothricin F(3+) | 
| ChEBI SMILES Value:  | 
 [H][C@]12N\\C(N[C@]1([H])C(=O)NC[C@H]2O)=[NH+]/[C@@H]1O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]1NC(=O)C[C@@H]([NH3+])CCC[NH3+] | 
| ChEBI Substance ID:  | 
 104222418 | 
| ChEBI URL:  | 
 ChEBI:60822 | 
| ChemSpider ID:  | 
 26332014 | 
| Ontomatica Chemical Accession Key (OnChAKey):  | 
 NRAUADCLPJTGSF_VLSXYIQESA_Q_000_000000 | 
| PubChem Compound ID:  | 
 49852374 |