| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
streptothricin D [CHEBI:60828] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:60828] |
| ChEBI Compound Description: |
A streptothricin in which the peptide side-chain consists of 3 units of beta-lysine. |
| ChEBI Compound Identification Number: |
60828 |
| ChEBI InChI Value: |
InChI=1S/C31H58N12O10/c32-7-1-4-15(33)10-20(46)37-8-2-5-16(34)11-21(47)38-9-3-6-17(35)12-22(48)40-25-26(49)27(53-30(36)51)19(14-44)52-29(25)43-31-41-23-18(45)13-39-28(50)24(23)42-31/h15-19,23-27,29,44-45,49H,1-14,32-35H2,(H2,36,51)(H,37,46)(H,38,47)(H,39,50)(H,40,48)(H2,41,42,43)/t15-,16-,17-,18+,19+,23+,24-,25+,26-,27-,29+/m0/s1 |
| ChEBI InChIKey Value: |
WUJTXMVGXDQPNN-OTQKCRDJSA-N |
| ChEBI Compound Name: |
streptothricin D |
| ChEBI SMILES Value: |
[H][C@]12N\C(N[C@]1([H])C(=O)NC[C@H]2O)=N/[C@@H]1O[C@H](CO)[C@H](OC(N)=O)[C@@H](O)[C@H]1NC(=O)C[C@@H](N)CCCNC(=O)C[C@@H](N)CCCNC(=O)C[C@@H](N)CCCN |
| ChEBI Substance ID: |
104222422 |
| ChEBI URL: |
ChEBI:60828 |
| ChemSpider ID: |
NS |
| Ontomatica Chemical Accession Key (OnChAKey): |
WUJTXMVGXDQPNN_OTQKCRDJSA_N_000_000000 |
| PubChem Compound ID: |
49852376 |