Item 1 of 1 (back to results) efavirenz 1,4-Dihydro-2H-3,1-benzoxazin-2-one substituted at the 4 position by cyclopropylethynyl and trifluoromethyl groups (S configuration) and at the 6 position by chlorine. A non-nucleoside reverse transcriptase inhibitor with activity against HIV, it is used with other antiretrovirals for combination therapy of HIV infection.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antiviral agent [CHEBI:22587] > antiviral drug [CHEBI:36044] > efavirenz [CHEBI:119486] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   antiviral drug [CHEBI:36044] (50)   efavirenz [CHEBI:119486] (1)  anti-HIV agent [CHEBI:64946] (126)   anti-HIV-1 agent [CHEBI:64947] (79)   HIV-1 reverse transcriptase inhibitor [CHEBI:53756] (30)   efavirenz [CHEBI:119486] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   efavirenz [CHEBI:119486] (1)  fluorine molecular entity [CHEBI:24062] (288)   organofluorine compound [CHEBI:37143] (275)   efavirenz [CHEBI:119486] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   efavirenz [CHEBI:119486] (1)  organofluorine compound [CHEBI:37143] (275)   efavirenz [CHEBI:119486] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   efavirenz [CHEBI:119486] (1)  organofluorine compound [CHEBI:37143] (275)   efavirenz [CHEBI:119486] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   efavirenz [CHEBI:119486] (1)  acetylenic compound [CHEBI:73474] (106)   efavirenz [CHEBI:119486] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   efavirenz [CHEBI:119486] (1)  polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   efavirenz [CHEBI:119486] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  oxacycle [CHEBI:38104] (2002)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzoxazine [CHEBI:46969] (6)   efavirenz [CHEBI:119486] (1)  carbocyclic compound [CHEBI:33598] (1130)   cyclopropanes [CHEBI:51454] (58)   efavirenz [CHEBI:119486] (1)  acetylenic compound [CHEBI:73474] (106)   efavirenz [CHEBI:119486] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   efavirenz [CHEBI:119486] (1)  organofluorine compound [CHEBI:37143] (275)   efavirenz [CHEBI:119486] (1) ChEBI Compound Accession Identifier:   [CHEBI:119486] ChEBI Compound Description:   1,4-Dihydro-2H-3,1-benzoxazin-2-one substituted at the 4 position by cyclopropylethynyl and trifluoromethyl groups (S configuration) and at the 6 position by chlorine. A non-nucleoside reverse transcriptase inhibitor with activity against HIV, it is used with other antiretrovirals for combination therapy of HIV infection. ChEBI Compound Identification Number:   119486 ChEBI InChI Value:   InChI=1S/C14H9ClF3NO2/c15-9-3-4-11-10(7-9)13(14(16,17)18,21-12(20)19-11)6-5-8-1-2-8/h3-4,7-8H,1-2H2,(H,19,20)/t13-/m0/s1 ChEBI InChIKey Value:   XPOQHMRABVBWPR-ZDUSSCGKSA-N ChEBI Compound Name:   efavirenz ChEBI SMILES Value:   FC(F)(F)[C@]1(OC(=O)Nc2ccc(Cl)cc12)C#CC1CC1 ChEBI Substance ID:   87350529 ChEBI URL:   ChEBI:119486 ChemSpider ID:   57715 Ontomatica Chemical Accession Key (OnChAKey):   XPOQHMRABVBWPR_ZDUSSCGKSA_N_000_000000 PubChem Compound ID:   64139