Item 1 of 1 (back to results) 2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid A pentacyclic triterpenoid that is urs-12-ene substituted by a carboxy group at position 28, alpha-configured hydroxy groups at positions 2 and 19 and an oxo group at position 3. Isolated from the whole plants of Geum japonicum, it exhibits activity against HIV-1 protease.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antiviral agent [CHEBI:22587] > anti-HIV agent [CHEBI:64946] > HIV protease inhibitor [CHEBI:35660] > 2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HIV agent [CHEBI:64946] (126)   HIV protease inhibitor [CHEBI:35660] (14)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   pentacyclic triterpenoid [CHEBI:25872] (112)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   pentacyclic triterpenoid [CHEBI:25872] (112)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  oxo carboxylic acid [CHEBI:25754] (273)   oxo monocarboxylic acid [CHEBI:35871] (198)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1)  organic hydroxy compound [CHEBI:33822] (3050)   polyol [CHEBI:26191] (437)   diol [CHEBI:23824] (172)   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid [CHEBI:65783] (1) ChEBI Compound Accession Identifier:   [CHEBI:65783] ChEBI Compound Description:   A pentacyclic triterpenoid that is urs-12-ene substituted by a carboxy group at position 28, alpha-configured hydroxy groups at positions 2 and 19 and an oxo group at position 3. Isolated from the whole plants of Geum japonicum, it exhibits activity against HIV-1 protease. ChEBI Compound Identification Number:   65783 ChEBI InChI Value:   InChI=1S/C30H46O5/c1-17-10-13-30(24(33)34)15-14-27(5)18(22(30)29(17,7)35)8-9-21-26(4)16-19(31)23(32)25(2,3)20(26)11-12-28(21,27)6/h8,17,19-22,31,35H,9-16H2,1-7H3,(H,33,34)/t17-,19-,20+,21-,22-,26+,27-,28-,29-,30+/m1/s1 ChEBI InChIKey Value:   LJORXTIGOHMBOS-OTRVPSFMSA-N ChEBI Compound Name:   2alpha,19alpha-dihydroxy-3-oxo-12-ursen-28-oic acid ChEBI SMILES Value:   [H][C@@]12CC[C@]3(C)[C@]([H])(CC=C4[C@]5([H])[C@](C)(O)[C@H](C)CC[C@@]5(CC[C@@]34C)C(O)=O)[C@@]1(C)C[C@@H](O)C(=O)C2(C)C ChEBI Substance ID:   160709528 ChEBI URL:   ChEBI:65783 ChemSpider ID:   552868 Ontomatica Chemical Accession Key (OnChAKey):   LJORXTIGOHMBOS_OTRVPSFMSA_N_000_000000 PubChem Compound ID:   637229