Item 1 of 1 (back to results) maprounic acid A pentacyclic triterpenoid isolated from Maprounea africana and has been shown to exhibit inhibitory activity against HIV-1 reverse transcriptase.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antiviral agent [CHEBI:22587] > anti-HIV agent [CHEBI:64946] > anti-HIV-1 agent [CHEBI:64947] > HIV-1 reverse transcriptase inhibitor [CHEBI:53756] > maprounic acid [CHEBI:73107] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   maprounic acid [CHEBI:73107] (1)  antimicrobial agent [CHEBI:33281] (927)   antiviral agent [CHEBI:22587] (216)   anti-HIV agent [CHEBI:64946] (126)   anti-HIV-1 agent [CHEBI:64947] (79)   HIV-1 reverse transcriptase inhibitor [CHEBI:53756] (30)   maprounic acid [CHEBI:73107] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   pentacyclic triterpenoid [CHEBI:25872] (112)   maprounic acid [CHEBI:73107] (1)  isoprenoid [CHEBI:24913] (1402)   terpenoid [CHEBI:26873] (1099)   triterpenoid [CHEBI:36615] (228)   pentacyclic triterpenoid [CHEBI:25872] (112)   maprounic acid [CHEBI:73107] (1)  heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   maprounic acid [CHEBI:73107] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   maprounic acid [CHEBI:73107] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   maprounic acid [CHEBI:73107] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic polycyclic compound [CHEBI:51958] (1654)   pentacyclic triterpenoid [CHEBI:25872] (112)   maprounic acid [CHEBI:73107] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  monocarboxylic acid [CHEBI:25384] (1620)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1)  organic hydroxy compound [CHEBI:33822] (3050)   hydroxy carboxylic acid [CHEBI:24669] (422)   hydroxy monocarboxylic acid [CHEBI:35868] (396)   maprounic acid [CHEBI:73107] (1) ChEBI Compound Accession Identifier:   [CHEBI:73107] ChEBI Compound Description:   A pentacyclic triterpenoid isolated from Maprounea africana and has been shown to exhibit inhibitory activity against HIV-1 reverse transcriptase. ChEBI Compound Identification Number:   73107 ChEBI InChI Value:   InChI=1S/C30H48O3/c1-25(2)16-17-30(24(32)33)15-10-21-28(6)12-8-19-26(3,4)23(31)11-14-27(19,5)20(28)9-13-29(21,7)22(30)18-25/h10,19-20,22-23,31H,8-9,11-18H2,1-7H3,(H,32,33)/t19-,20+,22-,23-,27-,28+,29+,30+/m0/s1 ChEBI InChIKey Value:   BHHPRAFMEFGOLZ-QVUWEPBXSA-N ChEBI Compound Name:   maprounic acid ChEBI SMILES Value:   [H][C@@]12CC[C@@]3(C)C4=CC[C@]5(CCC(C)(C)C[C@@]5([H])[C@]4(C)CC[C@]3([H])[C@@]1(C)CC[C@H](O)C2(C)C)C(O)=O ChEBI Substance ID:   162169199 ChEBI URL:   ChEBI:73107 ChemSpider ID:   141879 Ontomatica Chemical Accession Key (OnChAKey):   BHHPRAFMEFGOLZ_QVUWEPBXSA_N_000_000000 PubChem Compound ID:   161527