New Search

Item 1 of 1 (back to results)

macluraxanthone B
A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 3, 6 and 7, a dimethylallyl group at position 2 and a prenyl group at position 4. Isolated from Maclura tinctoria and Cudrania tricuspidata, it exhibits anti-HIV and antineoplastic activity.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antiviral agent [CHEBI:22587] > anti-HIV agent [CHEBI:64946] > macluraxanthone B [CHEBI:66649]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 macluraxanthone B [CHEBI:66649] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antiviral agent [CHEBI:22587] (216) 
 anti-HIV agent [CHEBI:64946] (126) 
 macluraxanthone B [CHEBI:66649] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 macluraxanthone B [CHEBI:66649] (1)
06. Name of Biological Source of Chemical 
06. Name of Biological Source of Chemical
 Plantae (1926) 
 Magnoliophyta (1872) 
 Magnoliopsida (1649) 
 Rosales (56) 
 Moraceae (39) 
 Maclura (4) 
 Maclura tinctoria (3)
07. Part of Biological Source of Chemical 
07. Part of Biological Source of Chemical
 unspecified structure [PO:0000004] (703)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 heterotricyclic compound [CHEBI:36688] (541) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
 organic polycyclic compound [CHEBI:51958] (1654) 
 organic tricyclic compound [CHEBI:51959] (755) 
 organic heterotricyclic compound [CHEBI:26979] (541) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 dibenzopyran [CHEBI:39203] (118) 
 xanthenes [CHEBI:38835] (118) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 ketone [CHEBI:17087] (1288) 
 cyclic ketone [CHEBI:3992] (644) 
 xanthones [CHEBI:51149] (37) 
 macluraxanthone B [CHEBI:66649] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 phenols [CHEBI:33853] (868) 
 polyphenol [CHEBI:26195] (189) 
 macluraxanthone B [CHEBI:66649] (1)
ChEBI Compound Accession Identifier  [CHEBI:66649]
ChEBI Compound Description  A member of the class of xanthones that is 9H-xanthen-9-one substituted by hydroxy groups at positions 1, 3, 6 and 7, a dimethylallyl group at position 2 and a prenyl group at position 4. Isolated from Maclura tinctoria and Cudrania tricuspidata, it exhibits anti-HIV and antineoplastic activity.
ChEBI Compound Identification Number  66649
ChEBI InChI Value  InChI=1S/C23H24O6/c1-6-23(4,5)18-20(27)12(8-7-11(2)3)22-17(21(18)28)19(26)13-9-14(24)15(25)10-16(13)29-22/h6-7,9-10,24-25,27-28H,1,8H2,2-5H3
ChEBI InChIKey Value  QFYDCUMYVXSZFJ-UHFFFAOYSA-N
ChEBI Compound Name  macluraxanthone B
ChEBI SMILES Value  CC(C)=CCc1c(O)c(c(O)c2c1oc1cc(O)c(O)cc1c2=O)C(C)(C)C=C
ChEBI Substance ID  160710510
ChEBI URL  ChEBI:66649
ChemSpider ID  4510200
Ontomatica Chemical Accession Key (OnChAKey)  QFYDCUMYVXSZFJ_UHFFFAOYSA_N_000_000000
PubChem Compound ID  5353737