New Search

Item 1 of 1 (back to results)

bedaquiline
A quinoline-based antimycobacterial drug used (as its fumarate salt) for the treatment of pulmonary multi-drug resistant tuberculosis by inhibition of ATP synthase, an enzyme essential for the replication of the mycobacteria.


Current search:

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 electron-transport chain inhibitor [CHEBI:38496] (27) 
 respiratory-chain inhibitor [CHEBI:38497] (23) 
 mitochondrial respiratory-chain inhibitor [CHEBI:25355] (18) 
 ATP synthase inhibitor [CHEBI:20854] (3) 
 bedaquiline [CHEBI:72292] (1)
 antimicrobial agent [CHEBI:33281] (927) 
 antibacterial agent [CHEBI:33282] (317) 
 antibacterial drug [CHEBI:36047] (177) 
 antimycobacterial drug [CHEBI:64912] (46) 
 antitubercular agent [CHEBI:33231] (29) 
 bedaquiline [CHEBI:72292] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 bedaquiline [CHEBI:72292] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 bromine molecular entity [CHEBI:22928] (199) 
 organobromine compound [CHEBI:37141] (138) 
 bedaquiline [CHEBI:72292] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bedaquiline [CHEBI:72292] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 bedaquiline [CHEBI:72292] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 bedaquiline [CHEBI:72292] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 bedaquiline [CHEBI:72292] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 bedaquiline [CHEBI:72292] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 bedaquiline [CHEBI:72292] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bedaquiline [CHEBI:72292] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 bedaquiline [CHEBI:72292] (1)
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 bedaquiline [CHEBI:72292] (1)
 organic amino compound [CHEBI:50047] (2472) 
 tertiary amino compound [CHEBI:50996] (199) 
 bedaquiline [CHEBI:72292] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 aromatic ether [CHEBI:35618] (353) 
 bedaquiline [CHEBI:72292] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 aromatic compound [CHEBI:33655] (3799) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 aromatic ether [CHEBI:35618] (353) 
 bedaquiline [CHEBI:72292] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 aromatic ether [CHEBI:35618] (353) 
 bedaquiline [CHEBI:72292] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 quinolines [CHEBI:26513] (132) 
 bedaquiline [CHEBI:72292] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 bedaquiline [CHEBI:72292] (1)
 aromatic ether [CHEBI:35618] (353) 
 bedaquiline [CHEBI:72292] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 organic hydroxy compound [CHEBI:33822] (3050) 
 alcohol [CHEBI:30879] (1371) 
 tertiary alcohol [CHEBI:26878] (183) 
 bedaquiline [CHEBI:72292] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 bedaquiline [CHEBI:72292] (1)
ChEBI Compound Accession Identifier  [CHEBI:72292]
ChEBI Compound Description  A quinoline-based antimycobacterial drug used (as its fumarate salt) for the treatment of pulmonary multi-drug resistant tuberculosis by inhibition of ATP synthase, an enzyme essential for the replication of the mycobacteria.
ChEBI Compound Identification Number  72292
ChEBI InChI Value  InChI=1S/C32H31BrN2O2/c1-35(2)19-18-32(36,28-15-9-13-22-10-7-8-14-26(22)28)30(23-11-5-4-6-12-23)27-21-24-20-25(33)16-17-29(24)34-31(27)37-3/h4-17,20-21,30,36H,18-19H2,1-3H3/t30-,32-/m1/s1
ChEBI InChIKey Value  QUIJNHUBAXPXFS-XLJNKUFUSA-N
ChEBI Compound Name  bedaquiline
ChEBI SMILES Value  COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)c1cccc2ccccc12
ChEBI Substance ID  160962911
ChEBI URL  ChEBI:72292
ChemSpider ID  4534966
Ontomatica Chemical Accession Key (OnChAKey)  QUIJNHUBAXPXFS_XLJNKUFUSA_N_000_000000
PubChem Compound ID  5388906