New Search

Item 1 of 1 (back to results)

silver(1+) sulfadiazinate
null


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antibacterial agent [CHEBI:33282] > antibacterial drug [CHEBI:36047] > silver(1+) sulfadiazinate [CHEBI:9142]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antibiotic [CHEBI:22582] (193) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 antibacterial agent [CHEBI:33282] (317) 
 antibacterial drug [CHEBI:36047] (177) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
08. Chemical Category 
08. Chemical Category
 transition element molecular entity [CHEBI:33497] (536) 
 d-block molecular entity [CHEBI:33676] (500) 
 copper group molecular entity [CHEBI:33745] (56) 
 silver molecular entity [CHEBI:33964] (13) 
 silver salt [CHEBI:33968] (4) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamidate [CHEBI:38116] (1) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamidate [CHEBI:38116] (1) 
 silver(1+) sulfadiazinate [CHEBI:9142] (1)
ChEBI Compound Accession Identifier  [CHEBI:9142]
ChEBI Compound Description  null
ChEBI Compound Identification Number  9142
ChEBI InChI Value  "InChI=1S/C10H9N4O2S.Ag/c11-8-2-4-9(5-3-8)17(15,16)14-10-12-6-1-7-13-10;/h1-7H,11H2;/q-1;+1"
ChEBI InChIKey Value  UEJSSZHHYBHCEL-UHFFFAOYSA-N
ChEBI Compound Name  silver(1+) sulfadiazinate
ChEBI SMILES Value  [Ag+].Nc1ccc(cc1)S(=O)(=O)[N-]c1ncccn1
ChEBI Substance ID  8146005
ChEBI URL  ChEBI:9142
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  UEJSSZHHYBHCEL_UHFFFAOYSA_N_000_000000
PubChem Compound ID  441244