Item 1 of 1 (back to results) flavokawain B A member of the class of chalcones that consists of trans-chalcone substituted by hydroxy group at positions 2' and methoxy groups at positions 4' and 6'. Isolated from Piper methysticum and Piper rusbyi, it exhibits antileishmanial, anti-inflammatory and antineoplastic activities.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > apoptosis inducer [CHEBI:68495] > flavokawain B [CHEBI:65899] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   apoptosis inducer [CHEBI:68495] (23)   flavokawain B [CHEBI:65899] (1)  metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   flavokawain B [CHEBI:65899] (1)  antimicrobial agent [CHEBI:33281] (927)   antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antileishmanial agent [CHEBI:70868] (22)   flavokawain B [CHEBI:65899] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   flavokawain B [CHEBI:65899] (1)  anti-inflammatory agent [CHEBI:67079] (79)   flavokawain B [CHEBI:65899] (1) 06. Name of Biological Source of Chemical  06. Name of Biological Source of Chemical  Plantae (1926)   Magnoliophyta (1872)   Magnoliopsida (1649)   Piperales (63)   Piperaceae (62)   Piper (62)   Piper methysticum (1)  Piper rusbyi (2) 07. Part of Biological Source of Chemical  07. Part of Biological Source of Chemical  unspecified structure [PO:0000004] (703)  plant structure [PO:0009011] (1497)   multi-tissue plant structure [PO:0025496] (1114)   plant organ [PO:0009008] (970)   phyllome [PO:0006001] (351)   leaf [PO:0025034] (351) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   flavokawain B [CHEBI:65899] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   chalcones [CHEBI:23086] (25)   flavokawain B [CHEBI:65899] (1)  flavonoids [CHEBI:72544] (433)   chalcones [CHEBI:23086] (25)   flavokawain B [CHEBI:65899] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   flavokawain B [CHEBI:65899] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   chalcones [CHEBI:23086] (25)   flavokawain B [CHEBI:65899] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   flavokawain B [CHEBI:65899] (1)  carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   chalcones [CHEBI:23086] (25)   flavokawain B [CHEBI:65899] (1)  organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1)  flavonoids [CHEBI:72544] (433)   chalcones [CHEBI:23086] (25)   flavokawain B [CHEBI:65899] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   flavokawain B [CHEBI:65899] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   chalcones [CHEBI:23086] (25)   flavokawain B [CHEBI:65899] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   aromatic compound [CHEBI:33655] (3799)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   flavokawain B [CHEBI:65899] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   flavokawain B [CHEBI:65899] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic aromatic compound [CHEBI:33659] (3593)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1)  aromatic ether [CHEBI:35618] (353)   methoxybenzene [CHEBI:51683] (61)   dimethoxybenzene [CHEBI:51681] (14)   flavokawain B [CHEBI:65899] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   alpha,beta-unsaturated ketone [CHEBI:51721] (238)   enone [CHEBI:51689] (233)   chalcones [CHEBI:23086] (25)   flavokawain B [CHEBI:65899] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   phenols [CHEBI:33853] (868)   flavokawain B [CHEBI:65899] (1) ChEBI Compound Accession Identifier:   [CHEBI:65899] ChEBI Compound Description:   A member of the class of chalcones that consists of trans-chalcone substituted by hydroxy group at positions 2' and methoxy groups at positions 4' and 6'. Isolated from Piper methysticum and Piper rusbyi, it exhibits antileishmanial, anti-inflammatory and antineoplastic activities. ChEBI Compound Identification Number:   65899 ChEBI InChI Value:   InChI=1S/C17H16O4/c1-20-13-10-15(19)17(16(11-13)21-2)14(18)9-8-12-6-4-3-5-7-12/h3-11,19H,1-2H3/b9-8+ ChEBI InChIKey Value:   QKQLSQLKXBHUSO-CMDGGOBGSA-N ChEBI Compound Name:   flavokawain B ChEBI SMILES Value:   COc1cc(O)c(C(=O)\C=C\c2ccccc2)c(OC)c1 ChEBI Substance ID:   160709584 ChEBI URL:   ChEBI:65899 ChemSpider ID:   4511912 Ontomatica Chemical Accession Key (OnChAKey):   QKQLSQLKXBHUSO_CMDGGOBGSA_N_000_000000 PubChem Compound ID:   5356121