Item 1 of 1 (back to results) motualevic acid F A 2H-azirine that is 2H-azirene-2-carboxylic acid substituted by a 13,13-dibromotrideca-1,12-dien-1-yl group at position 3 (the 2R stereoisomer). It is isolated from the marine sponge Siliquariaspongia sp. and exhibits antibacterial properties.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antibacterial agent [CHEBI:33282] > motualevic acid F [CHEBI:66406] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   motualevic acid F [CHEBI:66406] (1)  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   motualevic acid F [CHEBI:66406] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   motualevic acid F [CHEBI:66406] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   motualevic acid F [CHEBI:66406] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   motualevic acid F [CHEBI:66406] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   monocarboxylic acid [CHEBI:25384] (1620)   motualevic acid F [CHEBI:66406] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   motualevic acid F [CHEBI:66406] (1) ChEBI Compound Accession Identifier:   [CHEBI:66406] ChEBI Compound Description:   A 2H-azirine that is 2H-azirene-2-carboxylic acid substituted by a 13,13-dibromotrideca-1,12-dien-1-yl group at position 3 (the 2R stereoisomer). It is isolated from the marine sponge Siliquariaspongia sp. and exhibits antibacterial properties. ChEBI Compound Identification Number:   66406 ChEBI InChI Value:   InChI=1S/C16H23Br2NO2/c17-14(18)12-10-8-6-4-2-1-3-5-7-9-11-13-15(19-13)16(20)21/h9,11-12,15H,1-8,10H2,(H,20,21)/b11-9+/t15-/m1/s1 ChEBI InChIKey Value:   XWKHPPWOUIGVPT-SLZMIMFISA-N ChEBI Compound Name:   motualevic acid F ChEBI SMILES Value:   OC(=O)[C@@H]1N=C1\C=C\CCCCCCCCCC=C(Br)Br ChEBI Substance ID:   160645305 ChEBI URL:   ChEBI:66406 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   XWKHPPWOUIGVPT_SLZMIMFISA_N_000_000000 PubChem Compound ID:   25242627