Item 1 of 1 (back to results) trichodermin A tetracyclic spiroepoxide which acts as an antifungal and protein synthesis inhibitor.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antifungal agent [CHEBI:35718] > trichodermin [CHEBI:9688] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   protein synthesis inhibitor [CHEBI:48001] (19)   trichodermin [CHEBI:9688] (1)  antimicrobial agent [CHEBI:33281] (927)   antifungal agent [CHEBI:35718] (130)   trichodermin [CHEBI:9688] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   trichodermin [CHEBI:9688] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   trichodermin [CHEBI:9688] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   trichodermin [CHEBI:9688] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   trichodermin [CHEBI:9688] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   trichodermin [CHEBI:9688] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   trichodermin [CHEBI:9688] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   trichodermin [CHEBI:9688] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   cyclic ether [CHEBI:37407] (314)   epoxide [CHEBI:32955] (145)   trichodermin [CHEBI:9688] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterotetracyclic compound [CHEBI:38163] (128)   trichodermin [CHEBI:9688] (1) ChEBI Compound Accession Identifier:   [CHEBI:9688] ChEBI Compound Description:   A tetracyclic spiroepoxide which acts as an antifungal and protein synthesis inhibitor. ChEBI Compound Identification Number:   9688 ChEBI InChI Value:   InChI=1S/C17H24O4/c1-10-5-6-15(3)12(7-10)21-14-8-13(20-11(2)18)16(15,4)17(14)9-19-17/h7,12-14H,5-6,8-9H2,1-4H3/t12-,13-,14-,15+,16-,17-/m1/s1 ChEBI InChIKey Value:   HNEGCRMUYSKRRR-NWHWRWDZSA-N ChEBI Compound Name:   trichodermin ChEBI SMILES Value:   [H][C@]12C[C@@H](OC(C)=O)[C@](C)([C@@]3(C)CCC(C)=C[C@@]3([H])O1)[C@@]21CO1 ChEBI Substance ID:   96079560 ChEBI URL:   ChEBI:9688 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   HNEGCRMUYSKRRR_NWHWRWDZSA_N_000_000000 PubChem Compound ID:   442403