New Search

Item 1 of 1 (back to results)

echinocandin B
A cyclic hexapeptide echinocandin antibiotic isolated from Aspergillus nidulans var. echinulatus with specific anti-yeast activity.


Current search:

03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antifungal agent [CHEBI:35718] > echinocandin B [CHEBI:315018]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 antimicrobial agent [CHEBI:33281] (927) 
 antifungal agent [CHEBI:35718] (130) 
 echinocandin B [CHEBI:315018] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antiinfective agent [CHEBI:35441] (82) 
 echinocandin B [CHEBI:315018] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 lipid [CHEBI:18059] (3532) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 heteroorganic entity [CHEBI:33285] (15197) 
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carboxamide [CHEBI:37622] (1381) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
 organic amino compound [CHEBI:50047] (2472) 
 peptide [CHEBI:16670] (730) 
 lipopeptide [CHEBI:46895] (60) 
 echinocandin [CHEBI:57248] (4) 
 echinocandin B [CHEBI:315018] (1)
ChEBI Compound Accession Identifier  [CHEBI:315018]
ChEBI Compound Description  A cyclic hexapeptide echinocandin antibiotic isolated from Aspergillus nidulans var. echinulatus with specific anti-yeast activity.
ChEBI Compound Identification Number  315018
ChEBI InChI Value  InChI=1S/C52H81N7O16/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-38(65)53-35-26-37(64)48(71)57-50(73)42-43(66)29(2)27-59(42)52(75)40(31(4)61)55-49(72)41(45(68)44(67)32-21-23-33(62)24-22-32)56-47(70)36-25-34(63)28-58(36)51(74)39(30(3)60)54-46(35)69/h9-10,12-13,21-24,29-31,34-37,39-45,48,60-64,66-68,71H,5-8,11,14-20,25-28H2,1-4H3,(H,53,65)(H,54,69)(H,55,72)(H,56,70)(H,57,73)/b10-9-,13-12-/t29-,30+,31+,34+,35-,36-,37+,39-,40-,41-,42-,43-,44-,45-,48+/m0/s1
ChEBI InChIKey Value  FAUOJMHVEYMQQG-HVYQDZECSA-N
ChEBI Compound Name  echinocandin B
ChEBI SMILES Value  CCCCC\C=C/C\C=C/CCCCCCCC(=O)N[C@H]1C[C@@H](O)[C@@H](O)NC(=O)[C@@H]2[C@@H](O)[C@@H](C)CN2C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]2C[C@@H](O)CN2C(=O)[C@@H](NC1=O)[C@@H](C)O)[C@H](O)[C@@H](O)c1ccc(O)cc1)[C@@H](C)O
ChEBI Substance ID  85507135
ChEBI URL  ChEBI:315018
ChemSpider ID  8073802
Ontomatica Chemical Accession Key (OnChAKey)  FAUOJMHVEYMQQG_HVYQDZECSA_N_000_000000
PubChem Compound ID  9898144