Item 1 of 1 (back to results) alisiaquinone B A heteropentacyclic compound that is the 9-methoxy derivative of alisiaquinone A. An antiplasmodial drug isolated from New Caledonian deep water sponge.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820] > antiplasmodial drug [CHEBI:64915] > alisiaquinone B [CHEBI:65383] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   alisiaquinone B [CHEBI:65383] (1)  antimicrobial agent [CHEBI:33281] (927)   antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antiplasmodial drug [CHEBI:64915] (28)   alisiaquinone B [CHEBI:65383] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1)  hemiketal [CHEBI:59772] (21)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1)  p-block molecular entity [CHEBI:33675] (25343)   chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1)  hemiketal [CHEBI:59772] (21)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1)  organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   alisiaquinone B [CHEBI:65383] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   alisiaquinone B [CHEBI:65383] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   alisiaquinone B [CHEBI:65383] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   alisiaquinone B [CHEBI:65383] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1)  hemiketal [CHEBI:59772] (21)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1)  quinone [CHEBI:36141] (209)   alisiaquinone B [CHEBI:65383] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   alisiaquinone B [CHEBI:65383] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   alisiaquinone B [CHEBI:65383] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   alisiaquinone B [CHEBI:65383] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   alisiaquinone B [CHEBI:65383] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   alisiaquinone B [CHEBI:65383] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   alisiaquinone B [CHEBI:65383] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heteropentacyclic compound [CHEBI:38164] (100)   alisiaquinone B [CHEBI:65383] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   ketone [CHEBI:17087] (1288)   cyclic ketone [CHEBI:3992] (644)   quinone [CHEBI:36141] (209)   alisiaquinone B [CHEBI:65383] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   hemiacetal [CHEBI:5653] (52)   lactol [CHEBI:38131] (51)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1)  hemiketal [CHEBI:59772] (21)   cyclic hemiketal [CHEBI:59780] (20)   alisiaquinone B [CHEBI:65383] (1) ChEBI Compound Accession Identifier:   [CHEBI:65383] ChEBI Compound Description:   A heteropentacyclic compound that is the 9-methoxy derivative of alisiaquinone A. An antiplasmodial drug isolated from New Caledonian deep water sponge. ChEBI Compound Identification Number:   65383 ChEBI InChI Value:   InChI=1S/C22H22O6/c1-20-5-4-6-21(2)14-8-11-12(17(24)16(27-3)9-15(11)23)7-13(14)18(25)22(26,19(20)21)28-10-20/h7-9,19,26H,4-6,10H2,1-3H3/t19-,20-,21-,22+/m1/s1 ChEBI InChIKey Value:   FYMHBDYBAOKOHD-YSFYHYPLSA-N ChEBI Compound Name:   alisiaquinone B ChEBI SMILES Value:   [H][C@@]12[C@]3(C)CCC[C@]1(C)c1cc4C(=O)C=C(OC)C(=O)c4cc1C(=O)[C@]2(O)OC3 ChEBI Substance ID:   160709411 ChEBI URL:   ChEBI:65383 ChemSpider ID:   23330104 Ontomatica Chemical Accession Key (OnChAKey):   FYMHBDYBAOKOHD_YSFYHYPLSA_N_000_000000 PubChem Compound ID:   24970870