Item 1 of 1 (back to results) ciliatamide B A lipopeptide that contains N-methylphenylalanine and lysine as the amino acid residues linked to a octanoyl moiety via an amide linkage (the R,R stereoisomer). It is isolated from the deep sea sponge Aaptos ciliata and exhibits antileishmanial and moderate cytotoxicity towards HeLa cells.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > antimicrobial drug [CHEBI:36043] > antiprotozoal drug [CHEBI:35820] > antileishmanial agent [CHEBI:70868] > ciliatamide B [CHEBI:65631] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   metabolite [CHEBI:25212] (2692)   secondary metabolite [CHEBI:26619] (2225)   ciliatamide B [CHEBI:65631] (1)  antimicrobial agent [CHEBI:33281] (927)   antimicrobial drug [CHEBI:36043] (169)   antiprotozoal drug [CHEBI:35820] (168)   antileishmanial agent [CHEBI:70868] (22)   ciliatamide B [CHEBI:65631] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   ciliatamide B [CHEBI:65631] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   cyclic amide [CHEBI:3990] (252)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1)  primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   lipid [CHEBI:18059] (3532)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carboxamide [CHEBI:37622] (1381)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  organic amino compound [CHEBI:50047] (2472)   peptide [CHEBI:16670] (730)   lipopeptide [CHEBI:46895] (60)   ciliatamide B [CHEBI:65631] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   lactam [CHEBI:24995] (252)   caprolactam [CHEBI:23000] (6)   ciliatamide B [CHEBI:65631] (1) ChEBI Compound Accession Identifier:   [CHEBI:65631] ChEBI Compound Description:   A lipopeptide that contains N-methylphenylalanine and lysine as the amino acid residues linked to a octanoyl moiety via an amide linkage (the R,R stereoisomer). It is isolated from the deep sea sponge Aaptos ciliata and exhibits antileishmanial and moderate cytotoxicity towards HeLa cells. ChEBI Compound Identification Number:   65631 ChEBI InChI Value:   InChI=1S/C24H37N3O3/c1-3-4-5-6-10-16-22(28)27(2)21(18-19-13-8-7-9-14-19)24(30)26-20-15-11-12-17-25-23(20)29/h7-9,13-14,20-21H,3-6,10-12,15-18H2,1-2H3,(H,25,29)(H,26,30)/t20-,21-/m1/s1 ChEBI InChIKey Value:   FNPKNWJUFWGJJV-NHCUHLMSSA-N ChEBI Compound Name:   ciliatamide B ChEBI SMILES Value:   CCCCCCCC(=O)N(C)[C@H](Cc1ccccc1)C(=O)N[C@@H]1CCCCNC1=O ChEBI Substance ID:   160655772 ChEBI URL:   ChEBI:65631 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   FNPKNWJUFWGJJV_NHCUHLMSSA_N_000_000000 PubChem Compound ID:   25112530