Item 1 of 1 (back to results) pyrithiamine pyrophosphate A pyridinium ion that is the O-pyrophosphoryl derivative of pyrithiamine.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > pyrithiamine pyrophosphate [CHEBI:45395] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   pyrithiamine pyrophosphate [CHEBI:45395] (1) 08. Chemical Category  08. Chemical Category  ion [CHEBI:24870] (4391)   organic ion [CHEBI:25699] (3577)   organic cation [CHEBI:25697] (428)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  cation [CHEBI:36916] (947)   organic cation [CHEBI:25697] (428)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   organic ion [CHEBI:25699] (3577)   organic cation [CHEBI:25697] (428)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   monocyclic compound [CHEBI:33661] (2007)   heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  heteromonocyclic compound [CHEBI:33670] (2004)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organic heteromonocyclic compound [CHEBI:25693] (2004)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1)  organonitrogen heterocyclic compound [CHEBI:38101] (3202)   pyridines [CHEBI:26421] (254)   pyridinium ion [CHEBI:50334] (26)   pyrithiamine pyrophosphate [CHEBI:45395] (1) ChEBI Compound Accession Identifier:   [CHEBI:45395] ChEBI Compound Description:   A pyridinium ion that is the O-pyrophosphoryl derivative of pyrithiamine. ChEBI Compound Identification Number:   45395 ChEBI InChI Value:   InChI=1S/C14H20N4O7P2/c1-10-12(5-7-24-27(22,23)25-26(19,20)21)4-3-6-18(10)9-13-8-16-11(2)17-14(13)15/h3-4,6,8H,5,7,9H2,1-2H3,(H4-,15,16,17,19,20,21,22,23)/p+1 ChEBI InChIKey Value:   ZHKSTKOYQKNDSJ-UHFFFAOYSA-O ChEBI Compound Name:   pyrithiamine pyrophosphate ChEBI SMILES Value:   Cc1ncc(C[n+]2cccc(CCOP(O)(=O)OP(O)(O)=O)c2C)c(N)n1 ChEBI Substance ID:   160962767 ChEBI URL:   ChEBI:45395 ChemSpider ID:   NS Ontomatica Chemical Accession Key (OnChAKey):   ZHKSTKOYQKNDSJ_UHFFFAOYSA_O_000_000000 PubChem Compound ID:   5327150