Item 1 of 1 (back to results) benzo[d]isothiazol-3-one An organic heterobicyclic compound based on a fused 1,2-thiazole and benzene bicyclic ring skeleton, with the S atom positioned adjacent to one of the positions of ring fusion.

Current search: 03. Biological Effects of Specific Chemicals: antimicrobial agent [CHEBI:33281] > disinfectant [CHEBI:48219] > benzo[d]isothiazol-3-one [CHEBI:167099] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  antimicrobial agent [CHEBI:33281] (927)   disinfectant [CHEBI:48219] (9)   benzo[d]isothiazol-3-one [CHEBI:167099] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   hematologic agent [CHEBI:50248] (64)   platelet aggregation inhibitor [CHEBI:50427] (39)   benzo[d]isothiazol-3-one [CHEBI:167099] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   benzo[d]isothiazol-3-one [CHEBI:167099] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   benzo[d]isothiazol-3-one [CHEBI:167099] (1) ChEBI Compound Accession Identifier:   [CHEBI:167099] ChEBI Compound Description:   An organic heterobicyclic compound based on a fused 1,2-thiazole and benzene bicyclic ring skeleton, with the S atom positioned adjacent to one of the positions of ring fusion. ChEBI Compound Identification Number:   167099 ChEBI InChI Value:   InChI=1S/C7H5NOS/c9-7-5-3-1-2-4-6(5)10-8-7/h1-4H,(H,8,9) ChEBI InChIKey Value:   DMSMPAJRVJJAGA-UHFFFAOYSA-N ChEBI Compound Name:   benzo[d]isothiazol-3-one ChEBI SMILES Value:   O=c1[nH]sc2ccccc12 ChEBI Substance ID:   85362679 ChEBI URL:   ChEBI:167099 ChemSpider ID:   16567 Ontomatica Chemical Accession Key (OnChAKey):   DMSMPAJRVJJAGA_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   17520