New Search

Item 1 of 1 (back to results)

aminocyclopyrachlor
An organochlorine herbicide, the structure of which is that of pyrimidine-4-carboxylic acid substituted at positions 2, 5 and 6 by cyclopropyl, chloro and amino groups respectively.


Current search:

03. Biological Effects of Specific Chemicals: xenobiotic [CHEBI:35703] > synthetic auxin [CHEBI:26841] > aminocyclopyrachlor [CHEBI:62952]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 xenobiotic [CHEBI:35703] (25) 
 synthetic auxin [CHEBI:26841] (6) 
 aminocyclopyrachlor [CHEBI:62952] (1)
05. Industrial Uses 
05. Industrial Uses
 pesticide [CHEBI:25944] (211) 
 herbicide [CHEBI:24527] (48) 
 aminocyclopyrachlor [CHEBI:62952] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 organochlorine pesticide [CHEBI:38656] (60) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 organochlorine pesticide [CHEBI:38656] (60) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 organochlorine pesticide [CHEBI:38656] (60) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 diazines [CHEBI:38313] (288) 
 pyrimidines [CHEBI:39447] (260) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 cyclopropanes [CHEBI:51454] (58) 
 aminocyclopyrachlor [CHEBI:62952] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 organochlorine pesticide [CHEBI:38656] (60) 
 aminocyclopyrachlor [CHEBI:62952] (1)
ChEBI Compound Accession Identifier  [CHEBI:62952]
ChEBI Compound Description  An organochlorine herbicide, the structure of which is that of pyrimidine-4-carboxylic acid substituted at positions 2, 5 and 6 by cyclopropyl, chloro and amino groups respectively.
ChEBI Compound Identification Number  62952
ChEBI InChI Value  InChI=1S/C8H8ClN3O2/c9-4-5(8(13)14)11-7(3-1-2-3)12-6(4)10/h3H,1-2H2,(H,13,14)(H2,10,11,12)
ChEBI InChIKey Value  KWAIHLIXESXTJL-UHFFFAOYSA-N
ChEBI Compound Name  aminocyclopyrachlor
ChEBI SMILES Value  Nc1nc(nc(C(O)=O)c1Cl)C1CC1
ChEBI Substance ID  126522726
ChEBI URL  ChEBI:62952
ChemSpider ID  21442054
Ontomatica Chemical Accession Key (OnChAKey)  KWAIHLIXESXTJL_UHFFFAOYSA_N_000_000000
PubChem Compound ID  17747875