New Search

Item 1 of 1 (back to results)

pyrabactin
A sulfonamide obtained by formal condensation of the sulfo group of 4-bromonaphthalene-1-sulfonic acid with the exocyclic amino group of 2-pyridylmethylamine. Mimics the action of the abscisic acid, a phytohormone.


Current search:

03. Biological Effects of Specific Chemicals: growth regulator [CHEBI:39317] > plant growth regulator [CHEBI:26155] > pyrabactin [CHEBI:73159]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 pharmacological uses [CHEBI:52210] (736) 
 agonist [CHEBI:48705] (68) 
 abscisic acid receptor agonist [CHEBI:73191] (2) 
 pyrabactin [CHEBI:73159] (1)
 molecular messenger [CHEBI:33280] (92) 
 hormone [CHEBI:24621] (55) 
 pyrabactin [CHEBI:73159] (1)
 growth regulator [CHEBI:39317] (34) 
 plant growth regulator [CHEBI:26155] (21) 
 pyrabactin [CHEBI:73159] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 bromine molecular entity [CHEBI:22928] (199) 
 organobromine compound [CHEBI:37141] (138) 
 pyrabactin [CHEBI:73159] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 pyrabactin [CHEBI:73159] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 sulfonamide [CHEBI:35358] (106) 
 pyrabactin [CHEBI:73159] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 sulfur molecular entity [CHEBI:26835] (1541) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 pyrabactin [CHEBI:73159] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 pyrabactin [CHEBI:73159] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 homocyclic compound [CHEBI:33597] (1134) 
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 polycyclic compound [CHEBI:33635] (4078) 
 homopolycyclic compound [CHEBI:35295] (493) 
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 monocyclic compound [CHEBI:33661] (2007) 
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 heteromonocyclic compound [CHEBI:33670] (2004) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organic heteromonocyclic compound [CHEBI:25693] (2004) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 pyridines [CHEBI:26421] (254) 
 pyrabactin [CHEBI:73159] (1)
 carbocyclic compound [CHEBI:33598] (1130) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 carbopolycyclic compound [CHEBI:35294] (493) 
 carbobicyclic compound [CHEBI:36785] (199) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 benzenoid aromatic compound [CHEBI:33836] (730) 
 naphthalenes [CHEBI:25477] (89) 
 pyrabactin [CHEBI:73159] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 pyrabactin [CHEBI:73159] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organobromine compound [CHEBI:37141] (138) 
 pyrabactin [CHEBI:73159] (1)
ChEBI Compound Accession Identifier  [CHEBI:73159]
ChEBI Compound Description  A sulfonamide obtained by formal condensation of the sulfo group of 4-bromonaphthalene-1-sulfonic acid with the exocyclic amino group of 2-pyridylmethylamine. Mimics the action of the abscisic acid, a phytohormone.
ChEBI Compound Identification Number  73159
ChEBI InChI Value  InChI=1S/C16H13BrN2O2S/c17-15-8-9-16(14-7-2-1-6-13(14)15)22(20,21)19-11-12-5-3-4-10-18-12/h1-10,19H,11H2
ChEBI InChIKey Value  GJSDYQXOSHKOGX-UHFFFAOYSA-N
ChEBI Compound Name  pyrabactin
ChEBI SMILES Value  Brc1ccc(c2ccccc12)S(=O)(=O)NCc1ccccn1
ChEBI Substance ID  162169329
ChEBI URL  ChEBI:73159
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  GJSDYQXOSHKOGX_UHFFFAOYSA_N_000_000000
PubChem Compound ID  1125790