| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
glyphosine [CHEBI:63484] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:63484] |
| ChEBI Compound Description: |
A tertiary amino compound that consists of glycine bearing two N-phosphonomethyl substituents. |
| ChEBI Compound Identification Number: |
63484 |
| ChEBI InChI Value: |
InChI=1S/C4H11NO8P2/c6-4(7)1-5(2-14(8,9)10)3-15(11,12)13/h1-3H2,(H,6,7)(H2,8,9,10)(H2,11,12,13) |
| ChEBI InChIKey Value: |
OXHDYFKENBXUEM-UHFFFAOYSA-N |
| ChEBI Compound Name: |
glyphosine |
| ChEBI SMILES Value: |
OC(=O)CN(CP(O)(O)=O)CP(O)(O)=O |
| ChEBI Substance ID: |
135610602 |
| ChEBI URL: |
ChEBI:63484 |
| ChemSpider ID: |
16196 |
| Ontomatica Chemical Accession Key (OnChAKey): |
OXHDYFKENBXUEM_UHFFFAOYSA_N_000_000000 |
| PubChem Compound ID: |
17112 |