Select any link to see items in a related category.

more general categories	information about this item
03. Biological Effects of Specific Chemicals	03. Biological Effects of Specific Chemicals
biochemical uses [CHEBI:52206] (3306)
enzyme inhibitor [CHEBI:23924] (825)
carbonic anhydrase inhibitor [CHEBI:23018] (9)	acetazolamide [CHEBI:27690] (1)
05. Industrial Uses	05. Industrial Uses
pharmaceutical [CHEBI:52217] (1978)
drug [CHEBI:23888] (1930)
central nervous system drug [CHEBI:35470] (217)
central nervous system depressant [CHEBI:35488] (90)
anticonvulsant [CHEBI:35623] (39)	acetazolamide [CHEBI:27690] (1)
diuretic [CHEBI:35498] (18)	acetazolamide [CHEBI:27690] (1)
08. Chemical Category	08. Chemical Category
main group molecular entity [CHEBI:33579] (25650)
p-block molecular entity [CHEBI:33675] (25343)
pnictogen molecular entity [CHEBI:33302] (10027)
nitrogen molecular entity [CHEBI:51143] (7930)
amide [CHEBI:32988] (1863)
primary amide [CHEBI:33256] (1586)
sulfonamide [CHEBI:35358] (106)	acetazolamide [CHEBI:27690] (1)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	acetazolamide [CHEBI:27690] (1)
organonitrogen compound [CHEBI:35352] (6705)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	acetazolamide [CHEBI:27690] (1)
chalcogen molecular entity [CHEBI:33304] (15225)
oxygen molecular entity [CHEBI:25806] (14414)
organooxygen compound [CHEBI:36963] (11352)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	acetazolamide [CHEBI:27690] (1)
sulfur molecular entity [CHEBI:26835] (1541)
sulfur oxoacid derivative [CHEBI:33424] (628)
sulfonic acid derivative [CHEBI:33552] (393)
sulfonamide [CHEBI:35358] (106)	acetazolamide [CHEBI:27690] (1)
organochalcogen compound [CHEBI:36962] (11874)
organooxygen compound [CHEBI:36963] (11352)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	acetazolamide [CHEBI:27690] (1)
carbon group molecular entity [CHEBI:33582] (23847)
organic molecular entity [CHEBI:50860] (23769)
heteroorganic entity [CHEBI:33285] (15197)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
thiadiazoles [CHEBI:38099] (12)	acetazolamide [CHEBI:27690] (1)
organonitrogen compound [CHEBI:35352] (6705)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	acetazolamide [CHEBI:27690] (1)
organochalcogen compound [CHEBI:36962] (11874)
organooxygen compound [CHEBI:36963] (11352)
carboxamide [CHEBI:37622] (1381)
monocarboxylic acid amide [CHEBI:29347] (257)	acetazolamide [CHEBI:27690] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
thiadiazoles [CHEBI:38099] (12)	acetazolamide [CHEBI:27690] (1)
polyatomic entity [CHEBI:36357] (18777)
molecule [CHEBI:25367] (11520)
cyclic compound [CHEBI:33595] (7817)
monocyclic compound [CHEBI:33661] (2007)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
thiadiazoles [CHEBI:38099] (12)	acetazolamide [CHEBI:27690] (1)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
thiadiazoles [CHEBI:38099] (12)	acetazolamide [CHEBI:27690] (1)
heterocyclic compound [CHEBI:5686] (5275)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
thiadiazoles [CHEBI:38099] (12)	acetazolamide [CHEBI:27690] (1)
heteromonocyclic compound [CHEBI:33670] (2004)
organic heteromonocyclic compound [CHEBI:25693] (2004)
thiadiazoles [CHEBI:38099] (12)	acetazolamide [CHEBI:27690] (1)
organic molecule [CHEBI:72695] (11399)
organic cyclic compound [CHEBI:33832] (7633)
organic heterocyclic compound [CHEBI:24532] (5243)
organic heteromonocyclic compound [CHEBI:25693] (2004)
thiadiazoles [CHEBI:38099] (12)	acetazolamide [CHEBI:27690] (1)
heteroatomic molecular entity [CHEBI:37577] (13672)
oxoacid derivative [CHEBI:33241] (3254)
sulfur oxoacid derivative [CHEBI:33424] (628)
sulfonic acid derivative [CHEBI:33552] (393)
sulfonamide [CHEBI:35358] (106)	acetazolamide [CHEBI:27690] (1)
ChEBI Compound Accession Identifier:	[CHEBI:27690]
ChEBI Compound Description:	null
ChEBI Compound Identification Number:	27690
ChEBI InChI Value:	InChI=1S/C4H6N4O3S2/c1-2(9)6-3-7-8-4(12-3)13(5,10)11/h1H3,(H2,5,10,11)(H,6,7,9)
ChEBI InChIKey Value:	BZKPWHYZMXOIDC-UHFFFAOYSA-N
ChEBI Compound Name:	acetazolamide
ChEBI SMILES Value:	CC(=O)Nc1nnc(s1)S(N)(=O)=O
ChEBI Substance ID:	11533278
ChEBI URL:	ChEBI:27690
ChemSpider ID:	1909
Ontomatica Chemical Accession Key (OnChAKey):	BZKPWHYZMXOIDC_UHFFFAOYSA_N_000_000000
PubChem Compound ID:	1986