New Search

Item 2 of 12 (back to results)
Previous previous next Next

ochratoxin A
A phenylalanine derivative resulting from the formal condensation of the amino group of L-phenylalanine with the carboxy group of (3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carboxylic acid. It is among the most widely occurring food-contaminating mycotoxins, produced by Aspergillus ochraceus, Aspergillus carbonarius and Penicillium verrucosum.


Current search:

03. Biological Effects of Specific Chemicals: aetiopathogenetic uses [CHEBI:52209] > teratogenic agent [CHEBI:50905]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 metabolite [CHEBI:25212] (2692) 
 secondary metabolite [CHEBI:26619] (2225) 
 toxin [CHEBI:27026] (45) 
 mycotoxin [CHEBI:25442] (17) 
 ochratoxin A [CHEBI:7719] (1)
 biophysical uses [CHEBI:52208] (136) 
 membrane transport modulator [CHEBI:38632] (122) 
 calcium channel modulator [CHEBI:38808] (32) 
 calcium channel blocker [CHEBI:38215] (24) 
 ochratoxin A [CHEBI:7719] (1)
 aetiopathogenetic uses [CHEBI:52209] (178) 
 carcinogenic agent [CHEBI:50903] (40) 
 ochratoxin A [CHEBI:7719] (1)
 teratogenic agent [CHEBI:50905] (12) 
 ochratoxin A [CHEBI:7719] (1)
 poison [CHEBI:64909] (7) 
 nephrotoxin [CHEBI:61015] (5) 
 ochratoxin A [CHEBI:7719] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 s-block molecular entity [CHEBI:33674] (7287) 
 hydrogen molecular entity [CHEBI:33608] (6932) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 p-block molecular entity [CHEBI:33675] (25343) 
 halogen molecular entity [CHEBI:24471] (1475) 
 chlorine molecular entity [CHEBI:23117] (884) 
 organochlorine compound [CHEBI:36683] (543) 
 ochratoxin A [CHEBI:7719] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 ochratoxin A [CHEBI:7719] (1)
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 carboxamide [CHEBI:37622] (1381) 
 ochratoxin A [CHEBI:7719] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 ochratoxin A [CHEBI:7719] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 carboxamide [CHEBI:37622] (1381) 
 ochratoxin A [CHEBI:7719] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 carboxamide [CHEBI:37622] (1381) 
 ochratoxin A [CHEBI:7719] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 ochratoxin A [CHEBI:7719] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 ochratoxin A [CHEBI:7719] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 carboxamide [CHEBI:37622] (1381) 
 ochratoxin A [CHEBI:7719] (1)
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic amino compound [CHEBI:50047] (2472) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 organic acid [CHEBI:64709] (3008) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 oxacycle [CHEBI:38104] (2002) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 benzopyran [CHEBI:22727] (349) 
 2-benzopyran [CHEBI:38444] (21) 
 isochromanes [CHEBI:38762] (10) 
 ochratoxin A [CHEBI:7719] (1)
 organic oxo compound [CHEBI:36587] (5932) 
 carbonyl compound [CHEBI:36586] (5928) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 hydroxides [CHEBI:24651] (5641) 
 oxoacid [CHEBI:24833] (3119) 
 carbon oxoacid [CHEBI:35605] (3012) 
 carboxylic acid [CHEBI:33575] (3005) 
 amino acid [CHEBI:33709] (959) 
 modified amino acid [CHEBI:25359] (654) 
 phenylalanine derivative [CHEBI:25985] (13) 
 ochratoxin A [CHEBI:7719] (1)
 halide [CHEBI:37578] (1402) 
 organohalogen compound [CHEBI:36684] (976) 
 organochlorine compound [CHEBI:36683] (543) 
 ochratoxin A [CHEBI:7719] (1)
ChEBI Compound Accession Identifier  [CHEBI:7719]
ChEBI Compound Description  A phenylalanine derivative resulting from the formal condensation of the amino group of L-phenylalanine with the carboxy group of (3R)-5-chloro-8-hydroxy-3-methyl-1-oxo-3,4-dihydro-1H-2-benzopyran-7-carboxylic acid. It is among the most widely occurring food-contaminating mycotoxins, produced by Aspergillus ochraceus, Aspergillus carbonarius and Penicillium verrucosum.
ChEBI Compound Identification Number  7719
ChEBI InChI Value  InChI=1S/C20H18ClNO6/c1-10-7-12-14(21)9-13(17(23)16(12)20(27)28-10)18(24)22-15(19(25)26)8-11-5-3-2-4-6-11/h2-6,9-10,15,23H,7-8H2,1H3,(H,22,24)(H,25,26)/t10-,15+/m1/s1
ChEBI InChIKey Value  RWQKHEORZBHNRI-BMIGLBTASA-N
ChEBI Compound Name  ochratoxin A
ChEBI SMILES Value  C[C@@H]1Cc2c(Cl)cc(C(=O)N[C@@H](Cc3ccccc3)C(O)=O)c(O)c2C(=O)O1
ChEBI Substance ID  24712295
ChEBI URL  ChEBI:7719
ChemSpider ID  390954
Ontomatica Chemical Accession Key (OnChAKey)  RWQKHEORZBHNRI_BMIGLBTASA_N_000_000000
PubChem Compound ID  442530