Item 2 of 3 (back to results) previous next N-(3-oxohexanoyl)homoserine lactone A carboxamide resulting from the formal condensaton of the carboxy group of 3-oxohexanoic acid with the amino group of homoserine lactone.

Current search: 03. Biological Effects of Specific Chemicals: molecular messenger [CHEBI:33280] > signalling molecule [CHEBI:62488] > autoinducer [CHEBI:71338] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  molecular messenger [CHEBI:33280] (92)   signalling molecule [CHEBI:62488] (13)   autoinducer [CHEBI:71338] (3)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   p-block molecular entity [CHEBI:33675] (25343)   pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   amide [CHEBI:32988] (1863)   primary amide [CHEBI:33256] (1586)   carboxamide [CHEBI:37622] (1381)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  carboxamide [CHEBI:37622] (1381)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  carboxamide [CHEBI:37622] (1381)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organonitrogen compound [CHEBI:35352] (6705)   carboxamide [CHEBI:37622] (1381)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  carboxamide [CHEBI:37622] (1381)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  ester [CHEBI:35701] (3370)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   oxacycle [CHEBI:38104] (2002)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1)  organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic ester [CHEBI:33308] (1495)   lactone [CHEBI:25000] (516)   gamma-lactone [CHEBI:37581] (157)   N-(3-oxohexanoyl)homoserine lactone [CHEBI:29640] (1) ChEBI Compound Accession Identifier:   [CHEBI:29640] ChEBI Compound Description:   A carboxamide resulting from the formal condensaton of the carboxy group of 3-oxohexanoic acid with the amino group of homoserine lactone. ChEBI Compound Identification Number:   29640 ChEBI InChI Value:   InChI=1S/C10H15NO4/c1-2-3-7(12)6-9(13)11-8-4-5-15-10(8)14/h8H,2-6H2,1H3,(H,11,13) ChEBI InChIKey Value:   YRYOXRMDHALAFL-UHFFFAOYSA-N ChEBI Compound Name:   N-(3-oxohexanoyl)homoserine lactone ChEBI SMILES Value:   CCCC(=O)CC(=O)NC1CCOC1=O ChEBI Substance ID:   160655726 ChEBI URL:   ChEBI:29640 ChemSpider ID:   106440 Ontomatica Chemical Accession Key (OnChAKey):   YRYOXRMDHALAFL_UHFFFAOYSA_N_000_000000 PubChem Compound ID:   119133