Item 2 of 3 (back to results) previous next bedaquiline A quinoline-based antimycobacterial drug used (as its fumarate salt) for the treatment of pulmonary multi-drug resistant tuberculosis by inhibition of ATP synthase, an enzyme essential for the replication of the mycobacteria.

Current search: 03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > electron-transport chain inhibitor [CHEBI:38496] > respiratory-chain inhibitor [CHEBI:38497] > mitochondrial respiratory-chain inhibitor [CHEBI:25355] > ATP synthase inhibitor [CHEBI:20854] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  biochemical uses [CHEBI:52206] (3306)   enzyme inhibitor [CHEBI:23924] (825)   electron-transport chain inhibitor [CHEBI:38496] (27)   respiratory-chain inhibitor [CHEBI:38497] (23)   mitochondrial respiratory-chain inhibitor [CHEBI:25355] (18)   ATP synthase inhibitor [CHEBI:20854] (3)   bedaquiline [CHEBI:72292] (1)  antimicrobial agent [CHEBI:33281] (927)   antibacterial agent [CHEBI:33282] (317)   antibacterial drug [CHEBI:36047] (177)   antimycobacterial drug [CHEBI:64912] (46)   antitubercular agent [CHEBI:33231] (29)   bedaquiline [CHEBI:72292] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   bedaquiline [CHEBI:72292] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   bromine molecular entity [CHEBI:22928] (199)   organobromine compound [CHEBI:37141] (138)   bedaquiline [CHEBI:72292] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   bedaquiline [CHEBI:72292] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   bedaquiline [CHEBI:72292] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   bedaquiline [CHEBI:72292] (1)  organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   bedaquiline [CHEBI:72292] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   bedaquiline [CHEBI:72292] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organonitrogen compound [CHEBI:35352] (6705)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   bedaquiline [CHEBI:72292] (1)  organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   bedaquiline [CHEBI:72292] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   ether [CHEBI:25698] (876)   aromatic ether [CHEBI:35618] (353)   bedaquiline [CHEBI:72292] (1)  organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   bedaquiline [CHEBI:72292] (1)  organic amino compound [CHEBI:50047] (2472)   tertiary amino compound [CHEBI:50996] (199)   bedaquiline [CHEBI:72292] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  aromatic ether [CHEBI:35618] (353)   bedaquiline [CHEBI:72292] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   cyclic compound [CHEBI:33595] (7817)   homocyclic compound [CHEBI:33597] (1134)   carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  polycyclic compound [CHEBI:33635] (4078)   heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  homopolycyclic compound [CHEBI:35295] (493)   carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  bicyclic compound [CHEBI:33636] (1511)   heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  aromatic compound [CHEBI:33655] (3799)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  aromatic ether [CHEBI:35618] (353)   bedaquiline [CHEBI:72292] (1)  organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  aromatic ether [CHEBI:35618] (353)   bedaquiline [CHEBI:72292] (1)  heterocyclic compound [CHEBI:5686] (5275)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  heteropolycyclic compound [CHEBI:33671] (2613)   organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  heterobicyclic compound [CHEBI:33672] (1315)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic molecule [CHEBI:72695] (11399)   organic cyclic compound [CHEBI:33832] (7633)   organic heterocyclic compound [CHEBI:24532] (5243)   organonitrogen heterocyclic compound [CHEBI:38101] (3202)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  organic heteropolycyclic compound [CHEBI:38166] (2613)   organic heterobicyclic compound [CHEBI:27171] (1315)   quinolines [CHEBI:26513] (132)   bedaquiline [CHEBI:72292] (1)  carbocyclic compound [CHEBI:33598] (1130)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  carbopolycyclic compound [CHEBI:35294] (493)   carbobicyclic compound [CHEBI:36785] (199)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  organic aromatic compound [CHEBI:33659] (3593)   benzenoid aromatic compound [CHEBI:33836] (730)   naphthalenes [CHEBI:25477] (89)   bedaquiline [CHEBI:72292] (1)  aromatic ether [CHEBI:35618] (353)   bedaquiline [CHEBI:72292] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   organic hydroxy compound [CHEBI:33822] (3050)   alcohol [CHEBI:30879] (1371)   tertiary alcohol [CHEBI:26878] (183)   bedaquiline [CHEBI:72292] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organobromine compound [CHEBI:37141] (138)   bedaquiline [CHEBI:72292] (1) ChEBI Compound Accession Identifier:   [CHEBI:72292] ChEBI Compound Description:   A quinoline-based antimycobacterial drug used (as its fumarate salt) for the treatment of pulmonary multi-drug resistant tuberculosis by inhibition of ATP synthase, an enzyme essential for the replication of the mycobacteria. ChEBI Compound Identification Number:   72292 ChEBI InChI Value:   InChI=1S/C32H31BrN2O2/c1-35(2)19-18-32(36,28-15-9-13-22-10-7-8-14-26(22)28)30(23-11-5-4-6-12-23)27-21-24-20-25(33)16-17-29(24)34-31(27)37-3/h4-17,20-21,30,36H,18-19H2,1-3H3/t30-,32-/m1/s1 ChEBI InChIKey Value:   QUIJNHUBAXPXFS-XLJNKUFUSA-N ChEBI Compound Name:   bedaquiline ChEBI SMILES Value:   COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)c1cccc2ccccc12 ChEBI Substance ID:   160962911 ChEBI URL:   ChEBI:72292 ChemSpider ID:   4534966 Ontomatica Chemical Accession Key (OnChAKey):   QUIJNHUBAXPXFS_XLJNKUFUSA_N_000_000000 PubChem Compound ID:   5388906