| more general categories |
information about this item |
|
| 03. Biological Effects of Specific Chemicals |
 |
 |
|
03. Biological Effects of Specific Chemicals |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
 |
| 08. Chemical Category |
 |
 |
|
08. Chemical Category |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
achromobactin [CHEBI:61346] (1) |
|
 |
| ChEBI Compound Accession Identifier: |
[CHEBI:61346] |
| ChEBI Compound Description: |
A citrate siderophore possessing four carboxylate groups suitable for iron coordination. |
| ChEBI Compound Identification Number: |
61346 |
| ChEBI InChI Value: |
InChI=1S/C22H29N3O16/c26-12(23-6-3-11(16(30)31)25-14(28)2-5-22(25,40)19(36)37)9-20(38,17(32)33)10-15(29)41-8-7-24-13(27)1-4-21(24,39)18(34)35/h11,38-40H,1-10H2,(H,23,26)(H,30,31)(H,32,33)(H,34,35)(H,36,37)/p-4/t11?,20-,21?,22?/m1/s1 |
| ChEBI InChIKey Value: |
JIVPNYWQBCSFIL-MAVSXWESSA-J |
| ChEBI Compound Name: |
achromobactin |
| ChEBI SMILES Value: |
O[C@](CC(=O)NCCC(N1C(=O)CCC1(O)C([O-])=O)C([O-])=O)(CC(=O)OCCN1C(=O)CCC1(O)C([O-])=O)C([O-])=O |
| ChEBI Substance ID: |
111978194 |
| ChEBI URL: |
ChEBI:61346 |
| ChemSpider ID: |
26332205 |
| Ontomatica Chemical Accession Key (OnChAKey): |
JIVPNYWQBCSFIL_MAVSXWESSA_J_000_000000 |
| PubChem Compound ID: |
50909799 |