Item 15 of 43 (back to results) previous next melphalan A phenylalanine derivative comprising L-phenylalanine having [bis(2-chloroethyl)amino group at the 4-position on the phenyl ring.

Current search: 03. Biological Effects of Specific Chemicals: immunomodulator [CHEBI:50846] > immunosuppressive agent [CHEBI:35705] × Select any link to see items in a related category. more general categories    information about this item 03. Biological Effects of Specific Chemicals  03. Biological Effects of Specific Chemicals  aetiopathogenetic uses [CHEBI:52209] (178)   genotoxin [CHEBI:50902] (78)   mutagen [CHEBI:25435] (74)   alkylating agent [CHEBI:22333] (29)   melphalan [CHEBI:28876] (1)  carcinogenic agent [CHEBI:50903] (40)   melphalan [CHEBI:28876] (1)  immunomodulator [CHEBI:50846] (61)   immunosuppressive agent [CHEBI:35705] (43)   melphalan [CHEBI:28876] (1) 05. Industrial Uses  05. Industrial Uses  pharmaceutical [CHEBI:52217] (1978)   drug [CHEBI:23888] (1930)   antineoplastic agent [CHEBI:35610] (760)   melphalan [CHEBI:28876] (1) 08. Chemical Category  08. Chemical Category  main group molecular entity [CHEBI:33579] (25650)   s-block molecular entity [CHEBI:33674] (7287)   hydrogen molecular entity [CHEBI:33608] (6932)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  p-block molecular entity [CHEBI:33675] (25343)   halogen molecular entity [CHEBI:24471] (1475)   chlorine molecular entity [CHEBI:23117] (884)   organochlorine compound [CHEBI:36683] (543)   melphalan [CHEBI:28876] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   melphalan [CHEBI:28876] (1)  pnictogen molecular entity [CHEBI:33302] (10027)   nitrogen molecular entity [CHEBI:51143] (7930)   organonitrogen compound [CHEBI:35352] (6705)   nitrogen mustard [CHEBI:37598] (11)   melphalan [CHEBI:28876] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  chalcogen molecular entity [CHEBI:33304] (15225)   oxygen molecular entity [CHEBI:25806] (14414)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  carbon group molecular entity [CHEBI:33582] (23847)   organic molecular entity [CHEBI:50860] (23769)   heteroorganic entity [CHEBI:33285] (15197)   organonitrogen compound [CHEBI:35352] (6705)   nitrogen mustard [CHEBI:37598] (11)   melphalan [CHEBI:28876] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   melphalan [CHEBI:28876] (1)  organochalcogen compound [CHEBI:36962] (11874)   organooxygen compound [CHEBI:36963] (11352)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  organic amino compound [CHEBI:50047] (2472)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  organic acid [CHEBI:64709] (3008)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  polyatomic entity [CHEBI:36357] (18777)   molecule [CHEBI:25367] (11520)   organic molecule [CHEBI:72695] (11399)   organic oxo compound [CHEBI:36587] (5932)   carbonyl compound [CHEBI:36586] (5928)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  heteroatomic molecular entity [CHEBI:37577] (13672)   hydroxides [CHEBI:24651] (5641)   oxoacid [CHEBI:24833] (3119)   carbon oxoacid [CHEBI:35605] (3012)   carboxylic acid [CHEBI:33575] (3005)   amino acid [CHEBI:33709] (959)   modified amino acid [CHEBI:25359] (654)   phenylalanine derivative [CHEBI:25985] (13)   melphalan [CHEBI:28876] (1)  halide [CHEBI:37578] (1402)   organohalogen compound [CHEBI:36684] (976)   organochlorine compound [CHEBI:36683] (543)   melphalan [CHEBI:28876] (1) ChEBI Compound Accession Identifier:   [CHEBI:28876] ChEBI Compound Description:   A phenylalanine derivative comprising L-phenylalanine having [bis(2-chloroethyl)amino group at the 4-position on the phenyl ring. ChEBI Compound Identification Number:   28876 ChEBI InChI Value:   InChI=1S/C13H18Cl2N2O2/c14-5-7-17(8-6-15)11-3-1-10(2-4-11)9-12(16)13(18)19/h1-4,12H,5-9,16H2,(H,18,19)/t12-/m0/s1 ChEBI InChIKey Value:   SGDBTWWWUNNDEQ-LBPRGKRZSA-N ChEBI Compound Name:   melphalan ChEBI SMILES Value:   N[C@@H](Cc1ccc(cc1)N(CCCl)CCCl)C(O)=O ChEBI Substance ID:   111978138 ChEBI URL:   ChEBI:28876 ChemSpider ID:   405297 Ontomatica Chemical Accession Key (OnChAKey):   SGDBTWWWUNNDEQ_LBPRGKRZSA_N_000_000000 PubChem Compound ID:   460612