New Search

Item 15 of 16 (back to results)
Previous previous next Next

XL765
A sulfonamide obtained by formal condensation of the sulfonic acid group of 4-[(3-methoxy-4-methylbenzoyl)amino]benzenesulfonic acid with the primary aromatic amino group of N-(3,5-dimethoxyphenyl)quinoxaline-2,3-diamine. A dual PI3K/mTOR inhibitor used in cancer treatment.


Current search:

03. Biological Effects of Specific Chemicals: biochemical uses [CHEBI:52206] > enzyme inhibitor [CHEBI:23924] > lipid kinase inhibitor [CHEBI:50916]
×

Select any link to see items in a related category.

more general categories    information about this item
03. Biological Effects of Specific Chemicals 
03. Biological Effects of Specific Chemicals
 biochemical uses [CHEBI:52206] (3306) 
 enzyme inhibitor [CHEBI:23924] (825) 
 protein kinase inhibitor [CHEBI:37699] (69) 
 mTOR inhibitor [CHEBI:68481] (6) 
 XL765 [CHEBI:71958] (1)
 lipid kinase inhibitor [CHEBI:50916] (16) 
 phosphatidylinositol-3-OH kinase inhibitor [CHEBI:50914] (16) 
 XL765 [CHEBI:71958] (1)
05. Industrial Uses 
05. Industrial Uses
 pharmaceutical [CHEBI:52217] (1978) 
 drug [CHEBI:23888] (1930) 
 antineoplastic agent [CHEBI:35610] (760) 
 XL765 [CHEBI:71958] (1)
08. Chemical Category 
08. Chemical Category
 main group molecular entity [CHEBI:33579] (25650) 
 p-block molecular entity [CHEBI:33675] (25343) 
 pnictogen molecular entity [CHEBI:33302] (10027) 
 nitrogen molecular entity [CHEBI:51143] (7930) 
 amide [CHEBI:32988] (1863) 
 primary amide [CHEBI:33256] (1586) 
 sulfonamide [CHEBI:35358] (106) 
 XL765 [CHEBI:71958] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 XL765 [CHEBI:71958] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 XL765 [CHEBI:71958] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 XL765 [CHEBI:71958] (1)
 chalcogen molecular entity [CHEBI:33304] (15225) 
 oxygen molecular entity [CHEBI:25806] (14414) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 XL765 [CHEBI:71958] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 XL765 [CHEBI:71958] (1)
 sulfur molecular entity [CHEBI:26835] (1541) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 XL765 [CHEBI:71958] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 XL765 [CHEBI:71958] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 XL765 [CHEBI:71958] (1)
 carbon group molecular entity [CHEBI:33582] (23847) 
 organic molecular entity [CHEBI:50860] (23769) 
 heteroorganic entity [CHEBI:33285] (15197) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organonitrogen compound [CHEBI:35352] (6705) 
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 XL765 [CHEBI:71958] (1)
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 XL765 [CHEBI:71958] (1)
 organochalcogen compound [CHEBI:36962] (11874) 
 organooxygen compound [CHEBI:36963] (11352) 
 ether [CHEBI:25698] (876) 
 aromatic ether [CHEBI:35618] (353) 
 XL765 [CHEBI:71958] (1)
 carboxamide [CHEBI:37622] (1381) 
 monocarboxylic acid amide [CHEBI:29347] (257) 
 arenecarboxamide [CHEBI:22645] (45) 
 benzamides [CHEBI:22702] (45) 
 XL765 [CHEBI:71958] (1)
 organic amino compound [CHEBI:50047] (2472) 
 aromatic amine [CHEBI:33860] (91) 
 XL765 [CHEBI:71958] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic amine [CHEBI:33860] (91) 
 XL765 [CHEBI:71958] (1)
 aromatic ether [CHEBI:35618] (353) 
 XL765 [CHEBI:71958] (1)
 polyatomic entity [CHEBI:36357] (18777) 
 molecule [CHEBI:25367] (11520) 
 cyclic compound [CHEBI:33595] (7817) 
 polycyclic compound [CHEBI:33635] (4078) 
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 bicyclic compound [CHEBI:33636] (1511) 
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 aromatic compound [CHEBI:33655] (3799) 
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic amine [CHEBI:33860] (91) 
 XL765 [CHEBI:71958] (1)
 aromatic ether [CHEBI:35618] (353) 
 XL765 [CHEBI:71958] (1)
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic amine [CHEBI:33860] (91) 
 XL765 [CHEBI:71958] (1)
 aromatic ether [CHEBI:35618] (353) 
 XL765 [CHEBI:71958] (1)
 heterocyclic compound [CHEBI:5686] (5275) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 heteropolycyclic compound [CHEBI:33671] (2613) 
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 heterobicyclic compound [CHEBI:33672] (1315) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic molecule [CHEBI:72695] (11399) 
 organic cyclic compound [CHEBI:33832] (7633) 
 organic heterocyclic compound [CHEBI:24532] (5243) 
 organonitrogen heterocyclic compound [CHEBI:38101] (3202) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic heteropolycyclic compound [CHEBI:38166] (2613) 
 organic heterobicyclic compound [CHEBI:27171] (1315) 
 naphthyridine derivative [CHEBI:73539] (11) 
 quinoxaline derivative [CHEBI:38771] (6) 
 XL765 [CHEBI:71958] (1)
 organic aromatic compound [CHEBI:33659] (3593) 
 aromatic amine [CHEBI:33860] (91) 
 XL765 [CHEBI:71958] (1)
 aromatic ether [CHEBI:35618] (353) 
 XL765 [CHEBI:71958] (1)
 heteroatomic molecular entity [CHEBI:37577] (13672) 
 oxoacid derivative [CHEBI:33241] (3254) 
 sulfur oxoacid derivative [CHEBI:33424] (628) 
 sulfonic acid derivative [CHEBI:33552] (393) 
 sulfonamide [CHEBI:35358] (106) 
 XL765 [CHEBI:71958] (1)
ChEBI Compound Accession Identifier  [CHEBI:71958]
ChEBI Compound Description  A sulfonamide obtained by formal condensation of the sulfonic acid group of 4-[(3-methoxy-4-methylbenzoyl)amino]benzenesulfonic acid with the primary aromatic amino group of N-(3,5-dimethoxyphenyl)quinoxaline-2,3-diamine. A dual PI3K/mTOR inhibitor used in cancer treatment.
ChEBI Compound Identification Number  71958
ChEBI InChI Value  InChI=1S/C31H29N5O6S/c1-19-9-10-20(15-28(19)42-4)31(37)33-21-11-13-25(14-12-21)43(38,39)36-30-29(34-26-7-5-6-8-27(26)35-30)32-22-16-23(40-2)18-24(17-22)41-3/h5-18H,1-4H3,(H,32,34)(H,33,37)(H,35,36)
ChEBI InChIKey Value  HJSSPYJVWLTYHG-UHFFFAOYSA-N
ChEBI Compound Name  XL765
ChEBI SMILES Value  COc1cc(Nc2nc3ccccc3nc2NS(=O)(=O)c2ccc(NC(=O)c3ccc(C)c(OC)c3)cc2)cc(OC)c1
ChEBI Substance ID  160962902
ChEBI URL  ChEBI:71958
ChemSpider ID  NS
Ontomatica Chemical Accession Key (OnChAKey)  HJSSPYJVWLTYHG_UHFFFAOYSA_N_000_000000
PubChem Compound ID  49867926